Explanation:
Environment conservation is an umbrella term that defines anything we do to protect our planet and conserve its natural resources so that every living thing can have an improved quality of life. bolivianouft and 7 more users found this answer helpful.
Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543
You can't usually just use a single spectrum line to confirm the identity of an element because there are cases that the emission line id not clearly defined. When the emission line is very weak compared to surrounding noise, in which case the more datapoints you have to build up confidence for the existence of a particular emission spectra, the better.
Answer:
b. transfer of electron(s).
Explanation:
An oxidation-reduction also called a redox reaction is a
chemical reaction in which electrons are transferred of between two species of reactants. It is a chemical reaction where the oxidation number of an atom, ion, or molecule, increases or decreases by losing or gaining electrons
Answer:
(b). Mass and distance.
Explanation:
The gravitational force between two objects is given by Newton's law of universal gravitation. The formula is as follows :
Here,
G is universal gravitational constant
r is the distance between two objects
It is very clear that the gravitational force is directly proportional to the product of masses and inversely proportional to the square of the distance between them.
Hence, the two quantities are used to predict gravitational force according to Newton's law of universal gravitation are mass and distance.
