C. Melting ice.
It is C because melting ice is a change of state from solid to liquid which requires an addition of energy(or entropy) into the system.
Condensation of water occurs from a gas to a liquid state, which takes energy out of the system(water) and gives it to the surroundings(air around it). Freezing water is the same as condensation except for the state change. Deposition is simply gas to a solid instantaneously so you can again see it as with the other two examples.
Answer:
Mass = 36 g
Explanation:
Given data:
Mass of water formed = ?
Mass of hydrogen = 4.04 g
Mass of oxygen = 31.98 g
Solution:
Chemical equation:
2H₂ + O₂ → 2H₂O
Number of moles of hydrogen:
Number of moles = mass/molar mass
Number of moles = 4.04 g/ 2 g/mol
Number of moles = 2.02 mol
Number of moles of oxygen:
Number of moles = mass/molar mass
Number of moles = 31.98 g/ 32 g/mol
Number of moles = 1.0 mol
Now we will compare the moles of water with hydrogen and oxygen.
O₂ : H₂O
1 : 2
H₂ : H₂O
2 : 2
2.02 : 2.02
Number of moles of water formed by oxygen are less thus oxygen will limiting reactant.
Mass of water:
Mass = number of moles × molar mass
Mass = 2 mol × 18 g/mol
Mass = 36 g
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer:
Sugar, sodium chloride, and hydrophilic proteins are all substances that dissolve in water. Oils, fats, and certain organic solvents do not dissolve in water because they are hydrophobic.
And, water is called the "universal solvent" because it dissolves more substances than any other liquid. ... Water molecules have a polar arrangement of the oxygen and hydrogen atoms—one side (hydrogen) has a positive electrical charge and the other side (oxygen) had a negative charge.
I don't see any options so there i hope it helps .