Answer:
a.the smallest building blocks of matter
Explanation:
because atoms are the smallest building blocks of matter.
Answer:
M.Mass = 3.66 g/mol
Data Given:
M.Mass = M = ??
Density = d = 0.1633 g/L
Temperature = T = 273.15 K (Standard)
Pressure = P = 1 atm (standard)
Solution:
Let us suppose that the gas is an ideal gas. Therefore, we will apply Ideal Gas equation i.e.
P V = n R T ---- (1)
Also, we know that;
Moles = n = mass / M.Mass
Or, n = m / M
Substituting n in Eq. 1.
P V = m/M R T --- (2)
Rearranging Eq.2 i.e.
P M = m/V R T --- (3)
As,
Mass / Volume = m/V = Density = d
So, Eq. 3 can be written as,
P M = d R T
Solving for M.Mass i.e.
M = d R T / P
Putting values,
M = 0.1633 g/L × 0.08205 L.atm.K⁻¹.mol⁻¹ × 273.15 K / 1 atm
M = 3.66 g/mol
Answer:
<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u>
Explanation:
2H2S(g)⇋2H2(g)+S2(g)2H2S(g)⇋2H2(g)+S2(g)
The equilibrium constant expression in terms of concentrations is:
Kc=<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u><u>.</u>
Titanium is ductile and has high resistance for heat despite its strength.
Titanium (Ti), is a Group 4b chemical transition element, it has a silvery gray appearance. Its characteristics are as follows
- known as the strongest metal with high rigidity
- low-corrosion resistance
- low density
- heat resistance.
Because of these features, Titanium is widely used in building aircraft, missiles, and ships and also in the production of prosthetics.
I know the answer. It is 2 straight chains. lLOL
