The complete balanced chemical reaction is:
2 AgNO3 + Na2S --> 2 NaNO3 + Ag2S
First let us calculate the number of moles of AgNO3.
moles AgNO3 = 0.315 M * 0.035 L
moles AgNO3 = 0.011025 mol
From the reaction, 1 mole of Na2S is needed for every 2
moles of AgNO3 hence:
moles Na2S required = 0.011025 mol AgNO3 * (1 mol Na2S / 2
mol AgNO3)
moles Na2S required = 5.5125 x 10^-3 mol
Therefore volume required is:
volume Na2S = 5.5125 x 10^-3 mol / 0.260 M
<span>volume Na2S = 0.0212 L = 21.2 mL</span>
Answer:
When a substance is heated, it gains thermal energy. Therefore, its particles move faster and its temperature rises. When a substance is cooled, it loses thermal energy, which causes its particles to move more slowly and its temperature to drop.
It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs
Answer: b) Crash 2; the force on the cart was stronger in this crash, so the force on the skateboard was also stronger.
Explanation:
Answer : The molecule 
is a polar molecule.
Explanation :
Polar molecule : When the arrangement of the molecule is asymmetrical then the molecule is polar.
Non-polar molecule : When the arrangement of the molecule is symmetrical then the molecule is non-polar.
The given molecule is,
The electronegativities of oxygen and fluorine are different. The molecular geometry of is bent. As, Fluorine is more elctronegative than the oxygen. So, the arrows putting towards the more electronegative element i.e, fluorine. These arrows do not balance each other. Due to this, the asymmetrical arrangement of these bonds makes the molecule polar.
Hence, the given molecule is polar.
