All categories

3 years ago

Javier filled a measuring cup with 2/3 of a cup of vegetable oil. Then he poured 1/3 of a cup

Mathematics

1 answer:

xxTIMURxx [149]3 years ago

4 0

Answer:

1/3

Step-by-step explanation:

you have to subtract 1/3 from 2/3.

It would have been different if the question asked for taking away 1/3 of how much the cup was filled, though.

Hope this helps.

Good Luck

You might be interested in

Jada’s teacher ask her to write a three-digit number that uses the digit 4 once and the digit 7 twice. The value of one 7 needs

viva [34]

477

The value of the first 7 from the left is 70.

If you divide 70 by 10, you get the value of the second seven, 7.

Another way to know this is equivalent fractions:

1/10 = 7/10

10 X 7 = 70
1 X 7 = 7

6 0

3 years ago

Felipe Rivera's savings account has a balance of 2163 After 3 years what will the amount of interest be at 4%

Allisa [31]

$\bf ~~~~~~ \textit{Compound Interest Earned Amount} \\\\ A=P\left(1+\frac{r}{n}\right)^{nt} \quad \begin{cases} A=\textit{accumulated amount}\\ P=\textit{original amount deposited}\dotfill &\$2163\\ r=rate\to 4\%\to \frac{4}{100}\dotfill &0.04\\ n= \begin{array}{llll} \textit{times it compounds per year}\\ \textit{quarterly, thus four} \end{array}\dotfill &4\\ t=years\dotfill &3 \end{cases} \\\\\\ A=2163\left(1+\frac{0.04}{4}\right)^{4\cdot 3}\implies A=2163(1.01)^{12}\implies A\approx 2437.322540175$

3 0

3 years ago

CosA+cosB+cosC+cos(A+B+C)= cos(A+B).cos(B+C).cos(C+A)

RoseWind [281]

Answer:

cos (A+B+C)

Step-by-step explanation:

as A,B,C, are triangle we have A,B and C as 180

cost

8 0

3 years ago

Please help me solve what is on that document

In-s [12.5K]

The most misleading graph is graph B because the blue rectangle and the red rectangle do not have the same width when plotted on the same scale

<h3>The ratio of the median weekly earnings</h3>

From the graph, we have the median weekly earnings to be:

High school diploma = $750
Bachelor's degree = $1250

So, the ratio is:

Ratio = $750 : $1250

Simplify

Ratio = 3 : 5

Hence, the ratio of the median weekly earnings is 3 : 5

<h3>The ratio of the area of the red rectangle to the blue rectangle in graph A?</h3>

In (a), we have:

Ratio = 3 : 5

The scale on the horizontal axis is given as:

1 unit per grid mark

Both rectangles have a width of 1 unit.

So, we have:

Ratio = 3 * 1: 5 * 1

Simplify

Ratio = 3 : 5

Hence, the ratio of the area of the red rectangle to the blue rectangle in graph A is 3 : 5

<h3>The ratio of the area of the red rectangle to the blue rectangle in graph B?</h3>

In (a), we have:

Ratio = 3 : 5

The scale on the horizontal axis is given as:

1 unit per grid mark

The red rectangle has a width of 3 units, while the blue has 5 units as its width

So, we have:

Ratio = 3 * 3 : 5 * 5

Simplify

Ratio = 9 : 25

Hence, the ratio of the area of the red rectangle to the blue rectangle in graph B is 9 : 25

<h3>The ratio of the volume of the red cube to the blue cube in graph C?</h3>

In (a), we have:

Ratio = 3 : 5

The scale on the horizontal axis is given as:

1 unit per grid mark

The red rectangle has a width of 3 units, while the blue has 5 units as its width.

Since the base are squares, we have:

Ratio = 3 * 3 * 3 : 5 * 5 * 5

Simplify

Ratio = 27 : 125

Hence, the ratio of the volume of the red cube to the blue cube in graph C is 27 : 125

<h3>The most misleading graph</h3>

The most misleading graph is graph B.

This is so because the blue rectangle and the red rectangle do not have the same width when plotted on the same scale