Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer:
The correct answer is 8.79 × 10⁻² M.
Explanation:
Based on the given information, the mass of NaI given is 4.11 grams. The molecular mass of NaI is 149.89 gram per mole. The moles of NaI can be determined by using the formula,
No. of moles of NaI = Weight of NaI/ Molecular mass
= 4.11 / 149.89
= 0.027420
The vol. of the solution given is 312 ml or 0.312 L
The molarity can be determined by using the formula,
Molarity = No. of moles/ Volume of the solution in L
= 0.027420/0.312
= 0.0879 M or 8.79 × 10⁻² M
Yeah man I can help explain a little bit fits
Answer:
(i). C6H2COOH and Na2CO3(aq)
observation: <u>Bubbles</u><u> </u><u>of</u><u> </u><u>a</u><u> </u><u>colourless</u><u> </u><u>gas</u><u> </u><u>(</u><u>carbon</u><u> </u><u>dioxide</u><u> </u><u>gas</u><u>)</u>
(ii) CH3CH2CH2OH and KMnO4 /H
observation: <u>The</u><u> </u><u>orange</u><u> </u><u>solution</u><u> </u><u>turns</u><u> </u><u>green</u><u>.</u>
[<em>This</em><em> </em><em>is</em><em> </em><em>because</em><em> </em><em>oxidation</em><em> </em><em>of</em><em> </em><em>propanol</em><em> </em><em>to</em><em> </em><em>propanoic</em><em> </em><em>acid</em><em> </em><em>occurs</em>]
(iii) CH3CH2OH and CH3COOH + conc. H2SO4
observation: <u>A</u><u> </u><u>sweet</u><u> </u><u>fruity</u><u> </u><u>smell</u><u> </u><u>is</u><u> </u><u>formed</u><u>.</u>
[<em>This</em><em> </em><em>is</em><em> </em><em>because</em><em> </em><em>an</em><em> </em><em>ester</em><em>,</em><em> </em><em>diethylether</em><em> </em><em>is</em><em> </em><em>formed</em><em>]</em>
(iv) CH3CH = CHCH3 and Br2 /H2O
observation: <u>a</u><u> </u><u>brown</u><u> </u><u>solution</u><u> </u><u>is</u><u> </u><u>formed</u><u>.</u>
There is no path of electrons around the nucleus. There are however things called orbitals where you are likely to find electrons.