As the atomic number of elements increases across a period on the periodic table, the atomic radius

What is the frequency of a wave with a wavelength of 6.40x10^4 meters?

yKpoI14uk [10]

Answer:

frequency = 0.47×10⁴ Hz

Explanation:

Given data:

Wavelength of wave = 6.4× 10⁴ m

Frequency of wave = ?

Solution:

Formula:

Speed of wave = wavelength × frequency

Speed of wave = 3 × 10⁸ m/s

Now we will put the values in formula.

3 × 10⁸ m/s = 6.4× 10⁴ m × frequency

frequency = 3 × 10⁸ m/s / 6.4× 10⁴ m

frequency = 0.47×10⁴ /s

s⁻¹ = Hz

frequency = 0.47×10⁴ Hz

Thus the wave with wavelength of 6.4× 10⁴ m have 0.47×10⁴ Hz frequency.

4 0

3 years ago

Read 2 more answers

Calculate the percent of each component in the mixture. Show your calculations. Circle final answers.

Colt1911 [192]

Answer:

See Explanation

Explanation:

The question is incomplete; as the mixtures are not given.

However, I'll give a general explanation on how to go about it and I'll also give an example.

The percentage of a component in a mixture is calculated as:

$\%C_E = \frac{E}{T} * 100\%$

Where

E = Amount of element/component

T = Amount of all elements/components

Take for instance:

In $(Ca(OH)_2)$

The amount of all elements is: (i.e formula mass of $(Ca(OH)_2)$ )

$T = 1 * Ca + 2 * H + 2 * O$

$T = 1 * 40 + 2 * 1 + 2 * 16$

$T = 74$

The amount of calcium is: (i.e formula mass of calcium)

$E = 1 * Ca$

$E = 1 * 40$

$E = 40$

So, the percentage component of calcium is:

$\%C_E = \frac{E}{T} * 100\%$

$\%C_E = \frac{40}{74} * 100\%$

$\%C_E = \frac{4000}{74}\%$

$\%C_E = 54.05\%$

The amount of hydrogen is:

$E = 2 * H$

$E = 2 * 1$

$E = 2$

So, the percentage component of hydrogen is:

$\%C_E = \frac{E}{T} * 100\%$

$\%C_E = \frac{2}{74} * 100\%$

$\%C_E = \frac{200}{74}\%$

$\%C_E = 2.70\%$

Similarly, for oxygen:

The amount of oxygen is:

$E = 2 * O$

$E = 2 * 16$

$E = 32$

So, the percentage component of oxygen is:

$\%C_E = \frac{E}{T} * 100\%$

$\%C_E = \frac{32}{74} * 100\%$

$\%C_E = \frac{3200}{74}\%$

$\%C_E = 43.24\%$

5 0

2 years ago

How to balance this equation NH4OH+H3PO4=(NH4)3PO4+H2O with explainatio please

Maru [420]

Answer:

3 NH4OH (l) + H3PO4 (aq) → (NH4)3PO4 (aq) + 3 H2O (l)

Explanation:

This is an acid-base reaction (neutralization): NH4OH is a base, H3PO4 is an acid

5 0

1 year ago

Read 2 more answers

515282 quarts into milliliters. I

Minchanka [31]

Answer:

487638640,7819

dndndnndndbxbdbdbdbdb

6 0

3 years ago

Give me lil reasoning so I know your not lying for points

Natali5045456 [20]

Answer:

C. Tip had the lower pressure, it was 652.71mmHg

Explanation:

To answer this question you need to convert both values into a common unit so you can compare directly.

87kPa = 652.71 mmHg

4 0

3 years ago