What type of bond (covalent, polar covalent or ionic) does aspirin have?.

Chemistry

2 answers:

stira [4]3 years ago

6 0

Explanation:

A covalent bond is defined as the bond formed due to sharing of electrons. And, when there is difference in electronegativity of the combining atoms then there will be occurrence of partial charges.

Generally, non-metals form covalent bonds.

As the chemical formula of aspirin is $C_{9}H_{8}O_{4}$ . So, there are only non-metal atoms present which means electrons are shared among the combining atoms. But due to the difference in their electronegativity there is development of partial charges.

Thus, we can conclude that polar covalent bond is present in aspirin.

levacccp [35]3 years ago

5 0

Acetylsalicylic acid (ASA) or commonly known as aspirin is used as pain reliever, treatment for fever and inflammation. The type of bond that aspirin have is covalent bond. Covalent bond is when atoms share their electrons. Aspirin is made up of carbon, hydrogen and oxygen with a formula of C9H8O4.

You might be interested in

If 200 ml of 0.15 M propionic acid (PA) is added to 300 ml of 0.02 M NaOH, what is the resulting pH of the solution? Round the a

vodomira [7]

Answer:

pH = 4.543

Explanation:

CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
pKa = - Log Ka

∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]

∴ pKa = 4.87

⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]

added 300 mL 0f 0.02 M NaOH:

⇒ C CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)

⇒ C CH3CH2COOH = 0.048 M

⇒ C NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M

mass balance:

⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)

charge balance:

⇒ [H3O+] + [Na+] = [CH3CH2COO-]

∴ [Na+] = 0.02 M

⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)

(2) in (1):

⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]

replacing in Ka:

⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])

⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]

⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]

⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0

⇒ [H3O+ ] = 2.867 E-5 M

∴ pH = - Log [H3O+]

⇒ pH = 4.543

3 0

3 years ago

Which element would be expected to have chemical and physical properties closest to those of rubidium?

DIA [1.3K]

Rubidium is an element that belongs to Group 1. As such it will have physical properties similar to the other Group 1 elements. Rubidium is below Potassium in the periodic table but above Cesium. As such it would be most like one of those two elements.