Answer:
yes
Explanation:
this is because the formula equation shows the details on how they solved the equation
Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543
Answer:
A) Sample B has more calcium carbonate molecules
Explanation:
M = Molar mass of calcium carbonate = 100.0869 g/mol
= Avogadro's number = 
For the 4.12 g sample
Moles of a substance is given by

Number of molecules is given by

For the 19.37 g sample

Number of molecules is given by


So, sample B has more calcium carbonate molecules.
The ratio of the elements of carbon, oxygen, calcium atoms, ions, has to be same in both the samples otherwise the samples cannot be considered as calcium carbonate. Same is applicable for impurities. If there are impurites then the sample cannot be considered as calcium carbonate.
Answer: The correct answer is -297 kJ.
Explanation:
To solve this problem, we want to modify each of the equations given to get the equation at the bottom of the photo. To do this, we realize that we need SO2 on the right side of the equation (as a product). This lets us know that we must reverse the first equation. This gives us:
2SO3 —> O2 + 2SO2 (196 kJ)
Remember that we take the opposite of the enthalpy change (reverse the sign) when we reverse the equation.
Now, both equations have double the coefficients that we would like (for example, there is 2S in the second equation when we need only S). This means we should multiply each equation (and their enthalpy changes) by 1/2. This gives us:
SO3 —>1/2O2 + SO2 (98 kJ)
S + 3/2O2 —> SO3 (-395 kJ)
Now, we add the two equations together. Notice that the SO3 in the reactants in the first equation and the SO3 in the products of the second equation cancel. Also note that O2 is present on both sides of the equation, so we must subtract 3/2 - 1/2, giving us a net 1O2 on the left side of the equation.
S + O2 —> SO2
Now, we must add the enthalpies together to get our final answer.
-395 kJ + 98 kJ = -297 kJ
Hope this helps!
Answer:
12.50g
Explanation:
T½ = 2.5years
No = 100g
N = ?
Time (T) = 7.5 years
To solve this question, we'll have to find the disintegration constant λ first
T½ = In2 / λ
T½ = 0.693 / λ
λ = 0.693 / 2.5
λ = 0.2772
In(N/No) = -λt
N = No* e^-λt
N = 100 * e^-(0.2772*7.5)
N = 100*e^-2.079
N = 100 * 0.125
N = 12.50g
The sample remaining after 7.5 years is 12.50g