All categories

3 years ago

Need help please! Theres three parts to this that I don't understand at all

Chemistry

1 answer:

butalik [34]3 years ago

4 0

Answer:

Chemical reaction B governs the process

Explanation:

The first part of the question asks to convert the mass of the calcium carbonate given to number of moles.

Mathematically;

Number of moles = mass/molar mass

Molar mass of CaCO3 = 100 g/mol

So the number of moles of CaCO3 will be 2.49/100 = 0.0249 moles

The second part of the question asks to convert the mass of carbon iv oxide to moles of carbon iv oxide

Mathematically;

That is same as ;

Number of moles = mass/molar mass

molar mass of CO2 is 44 g/mol

Number of moles of CO2 = 1.13/44 = 0.0256 moles

Now, if we compare the values of these number of moles, we can see that there are almost equal.

What this means is that the number of moles of calcium carbonate reacted is equal to the number of moles of carbon iv oxide produced.

So what we conclude here is that we have an equal mole ratio between the two compounds.

So the reaction that would be the correct answer will present equal number of moles of carbon iv oxide and calcium carbonate

Thus, we can see that reaction B is the one that governs this process as it is the only reaction out of the three options that present the two compounds with equal number of moles.

You might be interested in

Formula equation is more informative than a word equation why

Taya2010 [7]

Answer:

yes

Explanation:

this is because the formula equation shows the details on how they solved the equation

6 0

2 years ago

If 200 ml of 0.15 M propionic acid (PA) is added to 300 ml of 0.02 M NaOH, what is the resulting pH of the solution? Round the a

vodomira [7]

Answer:

pH = 4.543

Explanation:

CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
pKa = - Log Ka

∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]

∴ pKa = 4.87

⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]

added 300 mL 0f 0.02 M NaOH:

⇒ C CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)

⇒ C CH3CH2COOH = 0.048 M

⇒ C NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M

mass balance:

⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)

charge balance:

⇒ [H3O+] + [Na+] = [CH3CH2COO-]

∴ [Na+] = 0.02 M

⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)

(2) in (1):

⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]

replacing in Ka:

⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])

⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]

⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]

⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0

⇒ [H3O+ ] = 2.867 E-5 M

∴ pH = - Log [H3O+]

⇒ pH = 4.543

3 0

3 years ago

I have 2 samples of solid chalk (aka calcium carbonate). Sample A has a total mass of 4.12 g and Sample B has a total mass of 19

IRINA_888 [86]

Answer:

A) Sample B has more calcium carbonate molecules

Explanation:

M = Molar mass of calcium carbonate = 100.0869 g/mol

$N_A$ = Avogadro's number = $6.022\times 10^{23}\ \text{mol}^{-1}$

For the 4.12 g sample

Moles of a substance is given by

$n=\dfrac{m}{M}\\\Rightarrow n=\dfrac{4.12}{100.0869}\\\Rightarrow n=0.0411\ \text{mol}$

Number of molecules is given by

$nN_A=0.0411\times 6.022\times 10^{23}=2.48\times 10^{22}\ \text{molecules}$

For the 19.37 g sample

$n=\dfrac{19.37}{100.0869}\\\Rightarrow n=0.193\ \text{mol}$

Number of molecules is given by

$nN_A=0.193\times 6.022\times 10^{23}=1.16\times 10^{23}\ \text{molecules}$

$1.16\times 10^{23}\ \text{molecules}>2.48\times 10^{22}\ \text{molecules}$

So, sample B has more calcium carbonate molecules.

The ratio of the elements of carbon, oxygen, calcium atoms, ions, has to be same in both the samples otherwise the samples cannot be considered as calcium carbonate. Same is applicable for impurities. If there are impurites then the sample cannot be considered as calcium carbonate.

7 0

3 years ago

Please review the attachment

astra-53 [7]

Answer: The correct answer is -297 kJ.

Explanation:

To solve this problem, we want to modify each of the equations given to get the equation at the bottom of the photo. To do this, we realize that we need SO2 on the right side of the equation (as a product). This lets us know that we must reverse the first equation. This gives us:

2SO3 —> O2 + 2SO2 (196 kJ)

Remember that we take the opposite of the enthalpy change (reverse the sign) when we reverse the equation.

Now, both equations have double the coefficients that we would like (for example, there is 2S in the second equation when we need only S). This means we should multiply each equation (and their enthalpy changes) by 1/2. This gives us:

SO3 —>1/2O2 + SO2 (98 kJ)

S + 3/2O2 —> SO3 (-395 kJ)

Now, we add the two equations together. Notice that the SO3 in the reactants in the first equation and the SO3 in the products of the second equation cancel. Also note that O2 is present on both sides of the equation, so we must subtract 3/2 - 1/2, giving us a net 1O2 on the left side of the equation.

S + O2 —> SO2

Now, we must add the enthalpies together to get our final answer.

-395 kJ + 98 kJ = -297 kJ

Hope this helps!

8 0

3 years ago

Read 2 more answers

If nitrogen-13 has a half life of 2.5 years, how much remains from a 100g sample after 7.5 years

Sonbull [250]

Answer:

12.50g

Explanation:

T½ = 2.5years

No = 100g

N = ?

Time (T) = 7.5 years

To solve this question, we'll have to find the disintegration constant λ first

T½ = In2 / λ

T½ = 0.693 / λ

λ = 0.693 / 2.5

λ = 0.2772

In(N/No) = -λt

N = No* e^-λt

N = 100 * e^-(0.2772*7.5)

N = 100*e^-2.079

N = 100 * 0.125

N = 12.50g

The sample remaining after 7.5 years is 12.50g

5 0

3 years ago