All categories

3 years ago

An excess of hydrogen ions in the body fluids can have fatal results because this can

Chemistry

1 answer:

valentinak56 [21]3 years ago

6 0

Answer:

An excess of hydrogen ions in the body fluids can have disastrous results because. excess hydrogen ions can break chemical bonds. excess hydrogen ions can kill living cells.

Explanation:

It is that because, excess hydrogen ions can change the shape of large complex molecules, rendering them non-functional.

You might be interested in

Helpppppp!!!!! It’s due today URGENT!!!!!

VladimirAG [237]

Answer:

Explanation:

2. a [CO3 2-][H3O+] / [H2O][HCO3-

b. [H2PO4-][H3O+]/[H3PO4][H2O]

5 0

3 years ago

What is the molar mass for FeBr3

AleksAgata [21]

Mass of Iron (Fe): 55.845Mass of Bromine (Br): 79.904
You need to multiply the mass of Br by 3 because there are 3 Bromine atoms.
(79.904)(3)+ 55.845= 239.712+55.845 = 295.557 g/mol

6 0

3 years ago

In a neutral atom, the number of protons is always equal to what other part of the atom?

Licemer1 [7]

Answer:

b. The number of electrons

Explanation:

A "neutral atom" has a neutral charge. This means that its charge is equal to zero. In order for the charges to cancel out each other, the atom's positive charge should be equal to the negative charge. These being said, the number of electrons (negatively-charged) is then equal to the number of protons (positively-charged). Those atoms which are not neutral are called "ions." This means that they either have more or less electrons than the protons.

7 0

2 years ago

Fog is an example of a

Crank

Answer:

colloidal system liquid dispersed in gas.

6 0

3 years ago

In science, we like to develop explanations that we can use to predict the outcome of events and phenomena. Try to develop an ex

Kay [80]

The question is incomplete. The complete question is :

In science, we like to develop explanations that we can use to predict the outcome of events and phenomena. Try to develop an explanation that tells how much NaOH needs to be added to a beaker of HCl to cause the color to change. Your explanation can be something like: The color change will occur when [some amount] of NaOH is added because the color change occurs when [some condition]. The goal for your explanation is that it describes the outcome of this example, but can also be used to predict the outcome of other examples of this phenomenon. Here's an example explanation: The color of the solution will change when 40 ml of NaOH is added to a beaker of HCl because the color always changes when 40ml of base is added. Although this explanation works for this example, it probably won't work in examples where the flask contains a different amount of HCl, such as 30ml. Try to make an explanation that accurately predicts the outcome of other versions of this phenomenon.

Solution :

Consider the equation of the reaction between NaOH and $HCl$

NaOH (aq) + HCl (aq) → NaCl(aq) + $H_2O (l)$

The above equation tells us that $1 \text{mole}$ of $NaOH$ reacts with $1 \text{mole}$ of $HCl$ .

So at the equivalence point, the moles of NaOH added = moles of $HCl$ present.

If the volume of the $HCl$ taken = $V_1$ mL and the conc. of $HCl$ = $M_1$ mole/L

The volume of NaOH added up to the color change = $V_2 \text{ and conc of NaOH = M}_2$ mole/L

Moles of $HCl$ taken = $V_1 \ mL \times M_1 \ mol/100 \ mL = V_2M_2 \times 10^{-3}$ moles.

The color change will occur when the moles of NaOH added is equal to the moles of $HCl$ taken.

Thus when $V_1 M_1 \times 10^{-3} = V_2M_2 \times 10^{-3}$

or when $V_1M_1 = V_2M_2$

or $V_2=\frac{V_1M_1}{M_2}$ mL of NaOH added, we observe the color change.

Where $V_1, M_1$ are the volume and molarity of the $HCl$ taken.

$M_2$ is the molarity of NaOH added.

When both the NaOH and $HCl$ are of the same concentrations, i.e. if $M_1=M_2$ , then $V_2=V_1$

Or the 40 mL of $HCl$ will need 40 mL of NaOH for a color change and

30 mL of $HCl$ would need 30 mL of NaOH for the color change (provided the concentration $M_1=M_2$ )

7 0

2 years ago