Equilibrium occurs when forward and reverse directions of a reversible reaction occur at the same rate so there is no overall change in the amounts of reactants and products.
It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs
Both have a continuous light spectra the fluorescent source makes a spectra with more intense bands of mercury
<span />
