It’s 8•15 which is 120 kg of potatoes
This problem is very easy to answer. You simply have to look at the subscripts of each element of the compound.
1. For caffeine, which has a molecular formula of C₈H₁₀N₄O₂, it contains 8 atoms of Carbon, 10 atoms of Hydrogen, 4 atoms of Nitrogen and 2 atoms of Oxygen.
2. For Iron(III) Sulfate, which has a molecular formula of Fe₂(SO₄)₃, it contains 2 atoms of Iron, 3 atoms of Sulfur, and 12 atoms of Oxygen.
Answer:
4) 1.5 mol
Explanation:
Well, the equation is already balanced and the mole to mole ratio of reactants and products are all 1. So if the limiting reactant is HCl and you have 1.5 mol, you do the mole to mole ratio with NaCl and since it is 1 to 1, there'd be 1.5 mol of NaCl.
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
