Answer is: D. Lewis base.
Lewis acid is a chemical element, molecule or ion that contains an empty orbital which is capable of accepting an electron pair from a Lewis base. A Lewis base is element, molecule or ion that has a filled orbital and has electron pair which is not involved in bonding and can give it to Lewis acid. Lewis base is for example ammonia (NH3).
Water behaves as a base in this reaction.
The Bronsted-Lowry definition is applied, because the reaction involves the transfer of H+ from one reactant to the other.
A Bronsted-Lowry base is defined as a substance that accepts a proton.
Because water gains a proton to form H3O+ in this particular reaction, it acts as a base
Answer:
Explanation:
2. a [CO3 2-][H3O+] / [H2O][HCO3-
b. [H2PO4-][H3O+]/[H3PO4][H2O]
Answer:
An ionic bond is an attraction between ions of opposite charge in an ionic compound.
<span>So what happens when there is more than one force? I like to think of net force as if two people were pulling on ropes attached to a big crate. If they pull the crate in the same direction, the crate will accelerate twice as quickly. If they pull in opposite directions with equal forces, the crate won’t move at all — these two forces cancel each other out. If one person pulls northwards and the other pulls eastwards, the crate will move to the north-east.
</span>
