Which best describes a photon?

How many moles are there in 24.0 grams of H2O

Nata [24]

Answer:So, one mole of water has a mass of 16 +1+1 = 18 grams. So, if one mole has a mass of 18 grams, 25 grams would have a mass of 25 grams/ 18 grams per mole or 1.39 moles

6 0

3 years ago

Read 2 more answers

How many moles of KBr will be produced from 10.51 moles of BaBr2?

gregori [183]

Answer:

21.02moles of KBr

Explanation:

Parameters given:

Number of moles BaBr₂ = 10.51moles

Complete reaction equation:

BaBr₂ + K₂SO₄ → KBr + BaSO₄

Upon inspecting the given equation, we find out that the atoms are not balanced on both sides of the equation:

The balanced equation is:

BaBr₂ + K₂SO₄ → 2KBr + BaSO₄

From the equation:

1 mole of BaBr₂ produces 2 moles of KBr

∴ 10.51 moles of BaBr₂ will yield (2 x 10.51) moles = 21.02moles of KBr

7 0

3 years ago

One reaction involved in the conversion of iron ore to the metal is FeO(s) + CO(g) → Fe(s) + CO2(g) Use Hess’s Law to calculate

Ugo [173]

Answer:

$\delta H_{rxn} = -66.0 \ kJ/mole$

Explanation:

Given that:

$3FeO_3_{(s)}+CO_{(g)} \to 2Fe_3O_4_{(s)} +CO_{2(g)} \ \ \delta H = -47.0 \ kJ/mole -- equation (1) \\ \\ \\ Fe_2O_3_{(s)} +3CO_{(g)} \to 2FE_{(s)} + 3CO_{2(g)} \ \ \delta H = -25.0 \ kJ/mole -- equation (2) \\ \\ \\ Fe_3O_4_{(s)} + CO_{(g)} \to 3FeO_{(s)} + CO_{2(g)} \ \delta H = 19.0 \ kJ/mole -- equation (3)$

From equation (3) , multiplying (-1) with equation (3) and interchanging reactant with the product side; we have:

$3FeO_{(s)} + CO_{2(g)} \to Fe_3O_4_{(s)} + CO_{(g)} \ \delta H = -19.0 \ kJ/mole -- equation (4)$

Multiplying (2) with equation (4) ; we have:

$6FeO_{(s)} + 2CO_{2(g)} \to 2Fe_3O_4_{(s)} + 2CO_{(g)} \ \delta H = -38.0 \ kJ/mole -- equation (5)$

From equation (1) ; multiplying (-1) with equation (1); we have:

$2Fe_3O_4_{(s)} +CO_{2(g)} \to 3FeO_3_{(s)}+CO_{(g)} \ \ \delta H = 47.0 \ kJ/mole -- equation (6)$

From equation (2); multiplying (3) with equation (2); we have:

$3 Fe_2O_3_{(s)} +9CO_{(g)} \to 6FE_{(s)} + 9CO_{2(g)} \ \ \delta H = -75.0 \ kJ/mole -- equation (7)$

Now; Adding up equation (5), (6) & (7) ; we get:

$6FeO_{(s)} + 2CO_{2(g)} \to 2Fe_3O_4_{(s)} + 2CO_{(g)} \ \delta H = -38.0 \ kJ/mole -- equation (5)$

$2Fe_3O_4_{(s)} +CO_{2(g)} \to 3FeO_3_{(s)}+CO_{(g)} \ \ \delta H = 47.0 \ kJ/mole -- equation (6)$

$3 Fe_2O_3_{(s)} +9CO_{(g)} \to 6FE_{(s)} + 9CO_{2(g)} \ \ \delta H = -75.0 \ kJ/mole -- equation (7)$

$FeO \ \ \ + \ \ \ CO \ \ \to \ \ \ \ Fe_{(s)} + \ \ CO_{2(g)} \ \ \ \delta H = - 66.0 \ kJ/mole$

$\delta H_{rxn} = \delta H_1 + \delta H_2 + \delta H_3$ (According to Hess Law)

$\delta H_{rxn} = (-38.0 + 47.0 + (-75.0)) \ kJ/mole$

$\delta H_{rxn} = -66.0 \ kJ/mole$

8 0

3 years ago

Three clues that indicate chemical change

Bad White [126]

Explanation:

temperature

taste

and acidity rate

4 0

2 years ago

Read 2 more answers

If 200 ml of 0.15 M propionic acid (PA) is added to 300 ml of 0.02 M NaOH, what is the resulting pH of the solution? Round the a

vodomira [7]

Answer:

pH = 4.543

Explanation:

CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
pKa = - Log Ka

∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]

∴ pKa = 4.87

⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]

added 300 mL 0f 0.02 M NaOH:

⇒ C CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)

⇒ C CH3CH2COOH = 0.048 M

⇒ C NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M

mass balance:

⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)

charge balance:

⇒ [H3O+] + [Na+] = [CH3CH2COO-]

∴ [Na+] = 0.02 M

⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)

(2) in (1):

⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]

replacing in Ka:

⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])

⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]

⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]

⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0

⇒ [H3O+ ] = 2.867 E-5 M

∴ pH = - Log [H3O+]

⇒ pH = 4.543

3 0

3 years ago