<span>The equation that represents the process of photosynthesis
is: </span>
<span>
</span>
<span>6CO2+12H2O+light->C6H12O6+6O2+6H2O</span>
<span>
</span>
<span>Photosynthesis is the
process in plants to make their food. This involves the use carbon dioxide to
react with water and make sugar or glucose as the main product and oxygen as a
by-product. Since we are not given the mass of CO2 in this problem, we assume that we have 1 g of CO2 available. We calculate as follows:</span>
<span>
</span>
<span>1 g CO2 ( 1 mol CO2 / 44.01 g CO2 ) ( 12 mol H2O / 6 mol CO2 ) ( 18.02 g / 1 mol ) = 0.82 g of H2O is needed</span>
<span>
</span>
However, if the amount given of CO2 is not one gram, then you can simply change the starting value in the calculation and solve for the mass of water needed.
<span>
</span>
Answer:
<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u>
Explanation:
2H2S(g)⇋2H2(g)+S2(g)2H2S(g)⇋2H2(g)+S2(g)
The equilibrium constant expression in terms of concentrations is:
Kc=<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u><u>.</u>
I picture is unclear but
I can help if u send me it
Answer:
Part a: <em>Units of k is </em>
<em> where reaction is first order in A and second order in B</em>
Part b: <em>Units of k is </em>
<em> where reaction is first order in A and second order overall.</em>
Part c: <em>Units of k is </em>
<em> where reaction is independent of the concentration of A and second order overall.</em>
Part d: <em>Units of k is </em>
<em> where reaction reaction is second order in both A and B.</em>
Explanation:
As the reaction is given as

where as the rate is given as
![r=k[A]^x[B]^y](https://tex.z-dn.net/?f=r%3Dk%5BA%5D%5Ex%5BB%5D%5Ey)
where x is the order wrt A and y is the order wrt B.
Part a:
x=1 and y=2 now the reaction rate equation is given as
![r=k[A]^1[B]^2](https://tex.z-dn.net/?f=r%3Dk%5BA%5D%5E1%5BB%5D%5E2)
Now the units are given as
![r=k[A]^1[B]^2\\M/s =k[M]^1[M]^2\\M/s =k[M]^{1+2}\\M/s =k[M]^{3}\\M^{1-3}/s =k\\M^{-2}s^{-1} =k](https://tex.z-dn.net/?f=r%3Dk%5BA%5D%5E1%5BB%5D%5E2%5C%5CM%2Fs%20%3Dk%5BM%5D%5E1%5BM%5D%5E2%5C%5CM%2Fs%20%3Dk%5BM%5D%5E%7B1%2B2%7D%5C%5CM%2Fs%20%3Dk%5BM%5D%5E%7B3%7D%5C%5CM%5E%7B1-3%7D%2Fs%20%3Dk%5C%5CM%5E%7B-2%7Ds%5E%7B-1%7D%20%3Dk)
The units of k is 
Part b:
x=1 and o=2
x+y=o
1+y=2
y=2-1
y=1
Now the reaction rate equation is given as
![r=k[A]^1[B]^1](https://tex.z-dn.net/?f=r%3Dk%5BA%5D%5E1%5BB%5D%5E1)
Now the units are given as
![r=k[A]^1[B]^1\\M/s =k[M]^1[M]^1\\M/s =k[M]^{1+1}\\M/s =k[M]^{2}\\M^{1-2}/s =k\\M^{-1}s^{-1} =k](https://tex.z-dn.net/?f=r%3Dk%5BA%5D%5E1%5BB%5D%5E1%5C%5CM%2Fs%20%3Dk%5BM%5D%5E1%5BM%5D%5E1%5C%5CM%2Fs%20%3Dk%5BM%5D%5E%7B1%2B1%7D%5C%5CM%2Fs%20%3Dk%5BM%5D%5E%7B2%7D%5C%5CM%5E%7B1-2%7D%2Fs%20%3Dk%5C%5CM%5E%7B-1%7Ds%5E%7B-1%7D%20%3Dk)
The units of k is 
Part c:
x=0 and o=2
x+y=o
0+y=2
y=2
y=2
Now the reaction rate equation is given as
![r=k[A]^0[B]^2](https://tex.z-dn.net/?f=r%3Dk%5BA%5D%5E0%5BB%5D%5E2)
Now the units are given as
![r=k[B]^2\\M/s =k[M]^2\\M/s =k[M]^{2}\\M^{1-2}/s =k\\M^{-1}s^{-1} =k](https://tex.z-dn.net/?f=r%3Dk%5BB%5D%5E2%5C%5CM%2Fs%20%3Dk%5BM%5D%5E2%5C%5CM%2Fs%20%3Dk%5BM%5D%5E%7B2%7D%5C%5CM%5E%7B1-2%7D%2Fs%20%3Dk%5C%5CM%5E%7B-1%7Ds%5E%7B-1%7D%20%3Dk)
The units of k is 
Part d:
x=2 and y=2
Now the reaction rate equation is given as
![r=k[A]^2[B]^2](https://tex.z-dn.net/?f=r%3Dk%5BA%5D%5E2%5BB%5D%5E2)
Now the units are given as
![r=k[A]^2[B]^2\\M/s =k[M]^2[M]^2\\M/s =k[M]^{2+2}\\M/s =k[M]^{4}\\M^{1-4}/s =k\\M^{-3}s^{-1} =k](https://tex.z-dn.net/?f=r%3Dk%5BA%5D%5E2%5BB%5D%5E2%5C%5CM%2Fs%20%3Dk%5BM%5D%5E2%5BM%5D%5E2%5C%5CM%2Fs%20%3Dk%5BM%5D%5E%7B2%2B2%7D%5C%5CM%2Fs%20%3Dk%5BM%5D%5E%7B4%7D%5C%5CM%5E%7B1-4%7D%2Fs%20%3Dk%5C%5CM%5E%7B-3%7Ds%5E%7B-1%7D%20%3Dk)
The units of k is 
Answer:In a physical change, atoms are not rearranged and the matter's physical and chemical properties are unchanged. Chemical changes, on the other hand, rearrange the atoms of matter in new combinations, resulting in matter with new physical and chemical properties.
Explanation:
easy