Answer:
Yes, Mass is conserved.
Explanation:
Every chemical reactions obey the law of conservation of mass. The law of conservation of mass states that in chemical reactions, mass is always constant.
Equation:
2Na + Cl₂ → 2NaCl
From the equation above, one can observe that the reaction started using 2 atoms of Na and it produced 2 atoms of the same element in NaCl. A molecule of Cl produced 2 atoms of Cl in the NaCl
Design a simple experiment to support your answer:
Aim: To demonstrate the law of conservation of mass
One Na atom weighs 23g
Two Na atom will weigh 2 x 23 = 46g
1 atom of Cl is 35.5g
1 molecule of Cl containing two atoms of Cl will weigh 2 x 35.5 = 71g
Total mass of reactants = mass of 2Na + 1Cl₂ = (46 + 71)g = 117g
On the product side, Mass of 1 NaCl = 23+ 35.5 = 58.5g
Two moles of NaCl will give 2 x 58.5g = 117g
Since the mass on both side is the same, one can say mass is conserved.
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Thermosoftening plastics melt when they are heated.This means that they can be recycled , which involves melting them before making a new product. Thermosoftening plastics do not have covalent bonds between neighbouring polymer molecules, so the molecules can move over each other when heated and the plastic melts.
<span>these include your skin, tears, mucus, cilia, stomach acid, urine flow, 'friendly' bacteria and white blood cells called neutrophils.</span>
Salt, silt, and clay particles
