Answer:
An ionic bond essentially donates an electron to the other atom participating in the bond, while electrons in a covalent bond are shared equally between the atoms. Ionic bonds form between a metal and a nonmetal. Covalent bonds form between two nonmetals
Answer:
Options B and C
Explanation:
Let's take a look at the options and get our answer by way of elimination. The basic definition of a neutral solution is given as;
A neutral solution is a substance which is neither acid nor basic . it has a PH of 7. it will have equal amount of H+ AND OH- ions in it.
a) a neutral solution does not contain any H3O+ or OH- This is wrong because take water as an example, it is neutral but contains both ions.
b) a neutral solution contains [H2O] = [H3O+]. This option is correct cause it is in line with the definition above.
c) an acidic solution has [H3O⁺] > [OH⁻]. Acidic solutions are any solution that has a higher concentration of hydrogen ions than water. This option is correct.
d) a basic solution does not contain any H3O⁺. This option is wrong. Basic solutions are any solution that has a higher concentration of hydroxide ions than water. This means they contain H3O⁺ but [OH⁻] is greater.
Answer:
<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u>
Explanation:
2H2S(g)⇋2H2(g)+S2(g)2H2S(g)⇋2H2(g)+S2(g)
The equilibrium constant expression in terms of concentrations is:
Kc=<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u><u>.</u>
Faster molecules have fewer collisions than slower molecules is True about molecular speed.
<h3>What is Molecular speed?</h3>
Molecular speed refers to the average distance gases or molecules travelled atca particular time rate.
It is valid in ideal gas, where the molecules do not interact with others.
Average molecular speed = Square root (3 (ideal gas constant) * (Temperature)/m)
Therefore, Faster molecules have fewer collisions than slower molecules is True about molecular speed.
Learn more about molecular speed from the link below.
brainly.com/question/14327643
