Chemical changes cause a substance to change into an entirely substance with a new chemical formula. Chemical changes are also known as chemical reactions. The “ingredients” of a reaction are called reactants, and the end results are called products.
It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs
<span>AX(aq)+BY(aq)→no precipitate
AX(aq)+BZ(aq)→precipitate
this two equations imply
</span>
AX(aq) is soluble and <span>BY(aq) is insoluble
the answer is
</span><span>E. BY</span>
A liquid becoming a gas. For instance water (liquid) turns into steam (gas).
MThe heat energy required to raise the temperature of 0.36Kg of copper from 22 c to 60 c is calculate using the following formula
MC delta T
m(mass)= 0.360kg in grams = 0.360 x1000 = 360 g
c(specific heat energy) = 0.0920 cal/g.c
delta T = 60- 23 = 37 c
heat energy is therefore= 360g x0.0920 cal/g.c x 37 c= 1225.44 cal
