<h3>
The supplements that are minerals are</h3>
- calcium
- sodium
- iron
- zinc
<u><em> Explanation</em></u>
- calcium and sodium are major minerals which are required by the body for
calcium- needed for muscle,hearing bone and for the support of synthesis and function of cells
sodium- is needed to control blood pressure and also for proper muscle and nerve function
- Zinc and iron are required in trace and both are needed for good health
1-energy
2- force
3- force
4- force
5- energy
6- energy
Answer:
<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u>
Explanation:
2H2S(g)⇋2H2(g)+S2(g)2H2S(g)⇋2H2(g)+S2(g)
The equilibrium constant expression in terms of concentrations is:
Kc=<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u><u>.</u>
1) Chemical equation
2Al + 6 HCl ---> 2Al Cl3 + 3 H2
2) molar ratios
2 mol Al : 3 moles H2
3) Proportion
2 mol Al / 3mol H2 = x / 9 mol H2
4) Solve for x
x = 9 mol H2 * 2 mol Al / 3 mol H2 = 6 mol Ag
Answer: 6 moles
Answer:
V₂ = 2.96 L
Explanation:
Given data:
Initial volume = 2.00 L
Initial temperature = 250°C
Final volume = ?
Final temperature = 500°C
Solution:
First of all we will convert the temperature into kelvin.
250+273 = 523 k
500+273= 773 k
According to Charles's law,
V∝ T
V = KT
V₁/T₁ = V₂/T₂
V₂ = T₂V₁/T₁
V₂ = 2 L × 773 K / 523 k
V₂ = 1546 L.K / 523 k
V₂ = 2.96 L
