<span>it tells you the sequence in which events occurred, not how long ago they occurred.</span>
A chemical reaction (signs)
- rusting
- change in base of chemical
- for example lets say u mix two chemicals, and then it becomes a different new chemical (it changed from the inside)
a physical
- a physical reaction is outer looks not inside.
- it changes on the outside, like changing a color
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer:
Balanced reaction:
3 H2 (g) + N2 (g) → 2 NH3 (g)
Use stoichiometry to convert g of H2 to g of NH3. The process would be:
g H2 → mol H2 → mol NH3 → g NH3
12.0 g H2 x (1 mol H2 / 2.02 g H2) x (2 mol NH3 / 3 mol H2) x (17.03 g NH3 / 1 mol NH3) = 67.4 g NH3
Explanation: See above
Hope this helps, friend.
