No, because humans are much more complex than peas.
Molar mass of ( NH₄)₃PO₄ = 14.01×3 + 1.01×12 + 30.97 + 16.00×4 = 149.12 g/mol. Mass of 0.183 mol ...
Answer:A compound is formed as a result of chemical reaction, between the constituent elements
Explanation:
A compound is formed as a result of chemical reaction, between the constituent elements. The properties of compound are different from the properties of the elements from which it is formed. Ex. Compounds can be further divided into three classes : acids, bases and salts, on the basis of their properties.
Answer:
<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u>
Explanation:
2H2S(g)⇋2H2(g)+S2(g)2H2S(g)⇋2H2(g)+S2(g)
The equilibrium constant expression in terms of concentrations is:
Kc=<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u><u>.</u>
Explanation:
Monitor the temperature of the water with the thermometer. Stop heating the water once it nears the boiling point of 100 degrees Celsius. Add copper(II) sulfate and stir until the heated solution is saturated. When the solution is saturated, copper(II) sulfate will not dissolve anymore
