The random molecular movement from higher concentration to lower concentration
Answer:
The answer to your question is: letter A.
Explanation:
A Covalent bond polar is between 2 non metals where one atom is bigger than the other one so the distribution of charges creates this polarity.
A. One atom attracts shared electrons more strongly than the other atom This is the correct definition of bond polar, one element is bigger and stronger than the other element.
B. One atom has transferred its electrons completely to another atom This definition is incorrect, it is the definition of ionic bonding.
C. A sea of electrons has been created between the elements This definition is incorrect for the polar bond, it describes a metallic bonding.
D. Two atoms are sharing electrons with equal attraction This definition is incorrect for a polar bond, but is the correct definition for nonpolar bonding.
Answer : The Lewis-dot structure of 
is shown below.
Explanation :
Lewis-dot structure : It shows the bonding between the atoms of a molecule and it also shows the unpaired electrons present in the molecule.
In the Lewis-dot structure the valance electrons are shown by 'dot'.
The given molecule is,
As we know that hydrogen has '1' valence electron and nitrogen has '5' valence electrons.
Therefore, the total number of valence electrons in = 5 + 3(1) = 8
According to Lewis-dot structure, there are 6 number of bonding electrons and 2 number of non-bonding electrons.
Now we have to determine the formal charge for each atom.
Formula for formal charge :
Hence, the Lewis-dot structure of is shown below.
Answer:
one-half
Explanation:
cuz for a first order reaction is a half life independent of concentration and constant over time
It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs
