Li+ has a smaller ionic radius than K+
and smaller molecules have more collisions/interactions between each other
<h3>What is ion-solvent interaction ?</h3>
In the case of ion-solvent interactions, the state in which the interac-tions exist is an obvious one; it is the situation in which ions are inside the solvent.
- Ions are charged particles, and charges interact with other charges. So there will also be ion-ion, as well as ion-solvent, interactions in the solution.
- In the process of solvation, ions are surrounded by a concentric shell of solvent. Solvation is the process of reorganizing solvent and solute molecules into solvation complexes.
Learn more about Ion-solvent interaction here:
brainly.com/question/21307101
#SPJ4
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
279 g * (1 mol/180.559g glucose) * (2 mol ethanol/1 mol glucose) * (46.068g ethanol/1mol) =
142 g ethanol produced
H20. 2 of hydrogen and oxygen
They don't change what the substance really is unlike chemical change. They chemical formula of the substance stays the same even though the substance can go under shape change.