All categories

4 years ago

SO2(g)+NaOH(s)=Na2SO3(s)+H2O

Chemistry

1 answer:

Lisa [10]4 years ago

6 0

Explanation:

SO2 + 2NaOH → Na2SO3 + H2O

 $...$ 

You might be interested in

Indicate the number of unpaired electrons for following: [noble gas]ns2np5

Fantom [35]

1 unpaired electron.

4 0

4 years ago

Under what conditions do you expect hydrogen gas to deviate from ideal gas behavior? Explain your answer.

Ostrovityanka [42]

Hydrogen is a non-polar gas with very weak intermolecular forces of attraction. Hydrogen will deviate from the ideal gas behavior at high pressure.

4 0

3 years ago

Can somebody please help me ! :(

Helen [10]

Answer:

325

Explanation:

velocity = 3250 Hz x 0.1 m

5 0

3 years ago

Read 2 more answers

Why are some substances not able to dissolve in water?

Gemiola [76]

Water is a polar molecule. If a solute dissolved in water is polar molecule, it will dissolve in water. If a solute dissolved in water is non-polar like oil it will not dissolve in water. Polar dissolves in polar.

5 0

3 years ago

A 50/50 blend of engine coolant and water (by volume) is usually used in an automobile's engine cooling system. If a car's cooli

Diano4ka-milaya [45]

Answer:

$\large \boxed{109.17 \, ^{\circ}\text{C}}$

Explanation:

Data:

50/50 ethylene glycol (EG):water

V = 4.70 gal

ρ(EG) = 1.11 g/mL

ρ(water) = 0.988 g/mL

Calculations:

The formula for the boiling point elevation ΔTb is

$\Delta T_{b} = iK_{b}b$

i is the van’t Hoff factor — the number of moles of particles you get from 1 mol of solute. For EG, i = 1.

1. Moles of EG

$\rm n = 0.50 \times \text{4.70 gal} \times \dfrac{\text{3.785 L}}{\text{1 gal}} \times \dfrac{\text{1000 mL}}{\text{1 L}} \times \dfrac{\text{1.11 g}}{\text{1 mL}} \times \dfrac{\text{1 mol}}{\text{62.07 g}} = \text{159 mol}$

2. Kilograms of water

$m = 0.50 \times \text{4.70 gal} \times \dfrac{\text{3.785 L}}{\text{1 gal}} \times \dfrac{\text{998 g}}{\text{1 L}} \times \dfrac{\text{1 kg}}{\text{1000 g}} = \text{8.88 kg}$

3. Molal concentration of EG

$b = \dfrac{\text{159 mol}}{\text{8.88 kg}} = \text{17.9 mol/kg}$

4. Increase in boiling point

$\rm \Delta T_{b} = iK_{b}b = 1 \times 0.512 \, \, ^{\circ}\text{C} \cdot kg \cdot mol^{-1} \, \times 17.9 \cdot mol \cdot kg^{-1} = 9.17 \, ^{\circ}\text{C}$

5. Boiling point

$\rm T_{b} = T_{b}^{\circ} + \Delta T_{b} = 100.00 \, ^{\circ}\text{C} + 9.17 \, ^{\circ}\text{C} = \mathbf{109.17 \, ^{\circ}C}\\\rm \text{The boiling point of the solution is $\large \boxed{\mathbf{109.17 \, ^{\circ}C}}$}$

7 0

3 years ago