Answer:
In organic chemistry, the structural formula shows the bonding and general layout of the molecule.
Explanation:
It can also help in naming the molecule, as many compounds with the same molecular formula have different structural formulas, for example cycloalkanes and alkenes, or aldehydes and ketones.
It tells us about the constituents of the compound, or in other words, the functional groups present. This enables us to predict what kind of properties the compound has and what kind of reactions it can undergo.
It can also help us determine the stereochemistry (shape and spatial orientation) of the compound. This is especially important in organic chemistry and organic chemstry, since certain important reactions will proceed if and only if a molecule with the right shape is employed.
<span>is a mixture that composes of components that aren't uniform or they have localized regions that all have different properties. Despite the term appearing to be highly scientific, there are various common substances that are heterogeneous mixtures
</span>
By stoichiometry and assume
that:
CxH2xOy + zO2 -> xCO2
+ xH2O
<span>
CO2: 9.48/44 = 0.215 mmol
H2O: 3.87/18 = 0.215 mmol
mass of C = 0.215 * 12 = 2.58 mg
mass of H = 0.215 * 2 * 1 = 0.43 mg
mass of O in ethylbutyrate = 4.17 - 2.58 - 0.43 = 1.11 mg
So C/O = 2.58/1.11 ≈ 3 </span>
<span>
Thus we have C3H6O</span>
<span> </span>
Unfortunately you did not specify the electronic configuration in the question, however since one of the answers must be a halogen, i took the liberty to attach an image with the configuration (both the simple numeric and spdf form) for all the halogen and all you have to do is match the electronic configuration you have in your question to the one in the table attached and you can then deduce the answer.
Hope this helps.
Answer:
<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u>
Explanation:
2H2S(g)⇋2H2(g)+S2(g)2H2S(g)⇋2H2(g)+S2(g)
The equilibrium constant expression in terms of concentrations is:
Kc=<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u><u>.</u>
