<span>The particles are far apart from each other.</span>
What exactly is the question you are asking?
Answer:
1670 ml
Explanation:
molarity x Volume (Liters) = moles => Volume (Liters) = moles/Molarity
Volume needed = 2.50mol/1.50M = 1.67 Liters = 1670 ml.
Answer:
Inside the nucleus, the attractive strong nuclear force between protons outweighs the repulsive electromagnetic force and keeps the nucleus stable. Outside the nucleus, the electromagnetic force is stronger and protons repel each other.
Explanation:
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
