Yes, it is correct...........
Both the batteries and fuel cells are portable resources, which transforms the chemical energy into electrical energy.
A battery will produce electricity from the energy it has accumulated inside the battery, while a fuel cell produces the electricity from the fuel in an external fuel tank. This signifies that while a battery may run dead, a fuel cell will produce electricity as long as there is a supply of fuel.
Besides building teeth and bones, calcium also keeps your blood and muscles moving and helps your nerves send messages from your brain to the rest of your body. Your body can't make calcium, so you need to get it from food or supplements. While you're pregnant, try to get at least 1,000 mg of calcium every day.
The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
