Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer:
19.8 kg of C₂H₂ is needed
Explanation:
We solve this by a rule of three:
If 1251 kJ of heat are relased in the combustion of 1 mol of acetylene
95.5×10⁴ kJ of heat may be released by the combustion of
(95.5×10⁴ kJ . 1) /1251kJ = 763.4 moles of C₂H₂
Let's convert the moles to mass → 763.4 mol . 26 g/1 mol = 19848 g
If we convert the mass from g to kg → 19848 g . 1kg / 1000g = 19.8 kg
Answer:
sp3 hybridization
Explanation:
Hybridization means the mixing of atomic orbitals to yield hybrid orbitals with characteristics that are different from that of the isolated atomic orbitals before the combination.
sp3 hybridization occurs when one s orbital is mixed with three p orbitals to yield four sp3 hybrid orbitals which can be used to bond to a central atom.
The central atom is then located at the center of a regular tetrahedron at a bond angle of 109°.
Answer:
Noble Gases are very stable because...
1) Noble Gases have a full octet
2) Low chemical reactivity
Explanation:
This means that is has 8 valence electrons so it won't need any more, so it is less likely to react with other substances.
<span>Made of cells
</span><span>Reproduce
</span><span>Grow and Develop
</span><span>Respond to their Environment
</span><span>Genetic code</span>
