All categories

2 years ago

Activation energy is (blank)

Chemistry

2 answers:

timurjin [86]2 years ago

7 0

B. The energy barrier between reactants and products

hope this helps!

sladkih [1.3K]2 years ago

6 0

Entropy and Free Energy Quiz

1) B

2) C

3) A

4) C

5) D

6) C

7) B

8) C

9) B

You might be interested in

The equilibrium constant, Kc, for the following reaction is 56.0 at 278 K. 2CH2Cl2(g) CH4(g) + CCl4(g) When a sufficiently large

BabaBlast [244]

Answer:

21.5 M

Explanation:

1) Equilibrium equation (given):

2CH₂Cl₂ (g) ⇄ CH₄ (g) + CCl₄ (g)

2) Write the concentration changes when some concentration, A, of CH₂Cl₂ (g) sample is introduced into an evacuated (empty) vessel:

2CH₂Cl₂ (g) ⇄ CH₄ (g) + CCl₄ (g)

A - x x x

3) Replace x with the known (found) equilibrium concentraion of CCl₄ (g) of 0.348 M

2CH₂Cl₂ (g) ⇄ CH₄ (g) + CCl₄ (g)

A - 0.3485 0.348 0.348

4) Write the equilibrium constant equation, replace the known values and solve for the unknown (A):

Kc = [ CH₄ (g) ] [ CCl₄ (g) ] / [ CH₂Cl₂ (g) ]²

56.0 = 0.348² / A²

A² = 56.0 / 0.348² = 462.

A = 21.5 M ← answer

7 0

2 years ago

Convert 8.7 mg to ibs

rjkz [21]

Answer:

Explanation:

6 0

3 years ago

Read 2 more answers

Combustion of hydrocarbons such as undecane (C_11H_24) produces carbon dioxide, a "greenhouse gas." Greenhouse gases in the Eart

bekas [8.4K]

Answer:

Volume of carbon dioxide is 428.23 L.

Explanation:

Below is the chemical reaction or chemical equation for the combustion of hydrocarbons such as undecane into carbon dioxide.

$C_{11}H_{24}(l) + 17O_{2}(g) \to 11CO_{2} (g) + 12H_2O(g)$

Here, undecane is in liquid form that reacts with gaseous oxygen (combustion) and produces carbon dioxide and water as a product in the gaseous form.

The molar mass of undecane = $156.31 g/mol.$

$\text{Number of moles} = \frac{260g}{156.31g/mol} = 1.66 \ mol.$

From the equation, it can be seen that 1 mole of undecane produces 11 moles of carbon dioxide. Therefore, 1.66 mol will produce 18.26 mol of carbon dioxide.

Now find the volume of 18.26 mol of carbon dioxide when the temperature is 13 degrees Celsius and pressure is 1 atm.

$V = \frac{nRT}{P} \\$

$V = \frac{18.26 \times 0.082 \times 286 \ K}{1atm} \\$

$V = 428.23 \ L$

6 0

2 years ago

When is di- used in the name of a hydrocarbon?

harkovskaia [24]

Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane

6 0

2 years ago

21. Apply Concepts Classify each reaction and balance the

adell [148]

The reactions are in order which includes combustion reaction, Hydration reaction, oxidation reaction, and displacement reaction.

a) A combustion reaction is a chemical reaction between a fuel and an oxidant where heat is released. The combustion reaction example is given below. It is a balanced chemical reaction.

2C₃H₆(g) + 9O₂(g) --------> 6CO₂(g) + 6H₂O(g)

b. A hydration reaction is a chemical reaction in which a molecule of water is added to another molecule. Here Aluminum oxide is added to water to form aluminum hydroxide.

4Al₂O3(s) + 6H₂O(l)------> 2Al(OH)3(s)

c. When a metal reacts with oxygen, the metal forms an oxide. Oxide is a compound of metal and oxygen. Here lithium metal reacts with oxygen to form lithium oxide.

2Li(s) + O₂(g)-----> Li₂O(s)

d. A displacement reaction is one in which a more reactive element displaces a less reactive element from a compound. Here Zinc is more reactive than silver, so silver was displaced to form Zinc Nitrate.

Zn(s) + 2AgNO₃(aq) -----> 2Ag(s) + Zn(NO₃)₂(aq)

To know more about reactions, click below:

brainly.com/question/11231920

#SPJ1

4 0

8 months ago