The name for Na2 O in chemistry

two people start out 100 meters apart from each other and start moving towards each other at the same time. One person is moving

andreev551 [17]

Answer:

1.332 meters per second. // 2.664 meters per second.

Explanation:

the slower person moved 33.3 meters, and the faster person moved 66.6 meters.

the slower person is moving 33.3 meters in 25 seconds, while the other person is moving 66.6 meters in 25 seconds

slower person moved 33.3/25 = 1.332 meters per second.

faster person moved 66.6/25 = 2.664 meters per second.

4 0

3 years ago

When is di- used in the name of a hydrocarbon?

harkovskaia [24]

Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane

6 0

3 years ago

Iron (III) oxide and hydrogen react to form iron and water, like this: Fe 03(s)+3H9)2Fe(s)+3HO) At a certain temperature, a chem

belka [17]

The question is incomplete, here is the complete question:

Iron (III) oxide and hydrogen react to form iron and water, like this:

$Fe_2O_3(s)+3H_2(g)\rightarrow 2Fe(s)+3H_2O(g)$

At a certain temperature, a chemist finds that a 8.9 L reaction vessel containing a mixture of iron(III) oxide, hydrogen, Iron, and water at equilibrium has the following composition.

Compound Amount

Fe₂O₃ 3.95 g

H₂ 4.77 g

Fe 4.38 g

H₂O 2.00 g

Calculate the value of the equilibrium constant Kc for this reaction. Round your answer to 2 significant digits.

Answer: The value of equilibrium constant for given equation is $1.0\times 10^{-4}$

Explanation:

To calculate the molarity of solution, we use the equation:

$\text{Molarity of the solution}=\frac{\text{Mass of solute}}{\text{Molar mass of solute}\times \text{Volume of solution (in L)}}$

For hydrogen gas:

Given mass of hydrogen gas = 4.77 g

Molar mass of hydrogen gas = 2 g/mol

Volume of the solution = 8.9 L

Putting values in above expression, we get:

$\text{Molarity of hydrogen gas}=\frac{4.77}{2\times 8.9}\\\\\text{Molarity of hydrogen gas}=0.268M$

For water:

Given mass of water = 2.00 g

Molar mass of water = 18 g/mol

Volume of the solution = 8.9 L

Putting values in above expression, we get:

$\text{Molarity of water}=\frac{2.00}{18\times 8.9}\\\\\text{Molarity of water}=0.0125M$

For the given chemical equation:

$Fe_2O_3(s)+3H_2(g)\rightarrow 2Fe(s)+3H_2O(g)$

The expression of equilibrium constant for above equation follows:

$K_{eq}=\frac{[H_2O]^3}{[H_2]^3}$

Concentration of pure solids and pure liquids are taken as 1 in equilibrium constant expression.

Putting values in above expression, we get:

$K_{c}=\frac{(0.0125)^3}{(0.268)^3}\\\\K_{c}=1.0\times 10^{-4}$

Hence, the value of equilibrium constant for given equation is $1.0\times 10^{-4}$

6 0

3 years ago

Suppose an object is moving through space in a straight line. What could cause the object to start moving in a circle?

MAVERICK [17]

It could pass by a large enough object that has enough gravity to pull the object into its orbit and the object would stay in orbit because it has centripetal force.

8 0

3 years ago

Read 2 more answers

What are two reasons why scientists use the metric system

omeli [17]

The metric system is used because it is based on the number 10. Ten is easy to use for mathematical operations and conversions.

It is also easy to use for scientific notation when you are referring to powers of ten. There are extremely large and extremely small numbers in science. Thus, scientific notation allows for accurate abbreviated ways to symbolize these numbers. For instance, if I were to say 1,000, in scientific notation it would be 1 x 10 ^3. If I was to say 1,000,000, I would scientifically write 1 x 10 ^6.

4 0

3 years ago

Read 2 more answers

The name for Na2 O in chemistry ​

The name for Na2 O in chemistry