Answer:
A. It is possible not all of the water was evaporated from the sand, causing the recovered mass to be higher
D. While drying the NaCl, the liquid boiled and some splattered out of the evaporating dish, causing the recovered mass to be higher.
Explanation:
Sand absorbs water and stores it. The sunlight causes the water to evaporate but sand can hold some of the water inside it. This results in increase in mass of the sand. The mass of sand before and after the water evaporation can be different.
The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
Answer:
Fossils, Glaciers, Coastlines.
Explanation:
Evidence of plate tectonic theory are fossils, fossils of the same species were found oceans apart. also glaciers evidence of glaciers were found in places with warm climates. coastlines coastlines look like they fit in a puzzle.
This is the full question
What is true when an ion is formed?
A There is an unequal number of electrons and neutrons.
B There is an unequal number of electrons and protons.
C The atom loses one or more protons.
D The atom loses one or more neutrons.
Answer:
B There is an unequal number of electrons and protons.
Explanation:
There are two kinds of ion, cation, and anion. Cathion is when an atom loses electrons, which makes it have more proton than the electron. This makes the charge positive. Anion is the opposite of cathion. It's formed when an atom receives electron, thus making its charge negative. Because of this, there is no ion that has equal electron and protons.