Answer:
1Au(s) + 3HNO₃(aq) + 4HCl(aq) → 1HAuCl₄(aq) + 3NO₂(g) + 3H₂O(l)
The function of HCl is oxidize the gold.
Explanation:
It is possible to balance the reaction seeing each compound as a variable and take an equation for each atom, thus:
Au(s) + HNO₃(aq) + HCl(aq) → HAuCl₄(aq) + NO₂(g) + H₂O(l)
a + b + c = d + e + f
Au: a = d <em>(1)</em>
H: b + c = d + 2f <em>(2)</em>
N: b = e <em>(3)</em>
O: 3b = 2e + f <em>(4)</em>
Cl = c = 4d <em>(5)</em>
Assuming <em><u>a = 1</u></em>:
<em><u>1 = d</u></em> <em>(1)</em>
<u><em>c = 4</em></u> <em>(5)</em>
b + 3 = 2f <em>(2)</em>
3b = 2e + f <em>(4)</em>
As b = e:
b = f <em>(4)</em>
<em><u>f = 3</u></em>; <em><u>b = 3</u></em>; <em><u>e = 3</u></em>
Thus, balanced reaction is:
1Au(s) + 3HNO₃(aq) + 4HCl(aq) → 1HAuCl₄(aq) + 3NO₂(g) + 3H₂O(l)
<em>The function of HCl is oxidize the gold</em> that before reaction is Au⁰ and afte ris Au⁺³
I hope it helps!
Answer:
Br⁻, Be²⁺, Li⁺ , O²⁻, N³⁻
Explanation:
Ions are formed when an atom lose or gain the electrons.
There are two types of ions.
Cations and anions
Cations:
When an atom lose the electron cations are formed and atom gain positive charge.
X → X⁺ + 1e⁻
Anion:
When an atom gain electron anion is formed and atom gain negative charge,
X + 1e⁻ → X⁻
In given list of elements Li and Be form positive ions because they easily lose their valance electrons.
Li → Li⁺ + 1e⁻
Be → Be²⁺ + 2e⁻
While oxygen, nitrogen and bromine gain the electrons easily to complete the octet and form negative ions.
Br + 1e⁻ → Br⁻
O + 2e⁻ → O²⁻
N + 3e⁻ → N³⁻
Explanation:
oxidation of Nitrogen in NO2 is +4
Hello)
1)CH3-CH(OH)-СН2-СН2-СН2-СН2-СН3---(H2SO4)--›CH3-CH=CH-CH2-CH2-CH2-CH3+H2O
2)2-methyl-l-cyclohexanol---(h2so4)--›CH2=C(CH3)-CH2-CH2-CH2-CH2-CH3+H2O
Answer:
0.316 m
Explanation:
The wavelength of an electromagnetic radiation is given by the formula :
Speed of the electromagnetic radiation/ frequency of the electromagnetic radiation
Speed of electromagnetic radiation is given by 3*10^8 m/s
Frequency of the electromagnetic radiation is 9.50*10^8 Hz
Substituting the relevant values in the above formula:
3*10^8/9.50*10^8 = 3/9.5=0.316 m
So the required wavelength is 0.316 m