All categories

3 years ago

Which product(s) would be obtained by the dehydration of 2-heptanol? of 2-methyl-l-cyclohexanol?

1 answer:

5 0

Hello)
1)CH3-CH(OH)-СН2-СН2-СН2-СН2-СН3---(H2SO4)--›CH3-CH=CH-CH2-CH2-CH2-CH3+H2O
2)2-methyl-l-cyclohexanol---(h2so4)--›CH2=C(CH3)-CH2-CH2-CH2-CH2-CH3+H2O

You might be interested in

When an irregularly shaped chunk of an unknown metal with a mass of 25.32 g was placed in a graduated cylinder containing 25.00

inn [45]

Answer: The density of the unknown metal is 7.86 g/ml.

Explanation:

Density is defined as the mass contained per unit volume.

$Density=\frac{mass}{Volume}$

Given : Mass of metal = 25.32 g

Volume of metal = volume of water displaced = (28.22 - 25.00) ml = 3.22 ml

Putting in the values we get:

$density=\frac{25.32g}{3.22ml}$

$Density=7.86g/ml$

Thus the density of the unknown metal is 7.86 g/ml

7 0

3 years ago

A hypothetical element, E, has two stable isotopes. One isotope has a natural abundance of 68.037% and has an atomic mass of 46.

I am Lyosha [343]

If the abundance of the first isotope is 68.037%, then the abundance of the second isotope is 100%-68.037%.

Substituting into the atomic mass formula,

$47.574=(46.449)(0.68037)+x(1-0.68037)\\\\ 47.574=31.60250613+0.31963x\\\\15.97149387=0.31963x\\\\x \approx \boxed{49.969 \text{ u}}$

6 0

2 years ago

_____ bonds are formed when the electronegativity difference is 0.4 > 2.0. Give two examples:

34kurt

Ionic Bond is formed when the electronegativity difference is 0.4 > 2.0. Electronegativity is a term that can be defined as a tendency of an atom to attract electron towards its own self.

Explanation:

Electronegativity is a term that can be defined as a tendency of an atom to attract electron towards its own self.

An electronegativity of an atom is affected by

The atomic number of the atom
Secondly by the distance at which the valence electron are residing from the nucleus

1. In case the electronegativity difference (which is denoted by ΔEN) is less than 0.5 then the bond formed is known as Nonpolar covalent.

2. In case the ΔEN is in between 0.5 and 1.6, the bond formed is referred to as the Polar covalent

3. In case the ΔEN is more /greater than 2.0, then the bond formed is referred to as Ionic Bond

2 Examples of Ionic bonds

The formation of sodium fluoride, NaF, from a sodium atom and a fluorine atom is an example of Ionic bond formation.
Another example is the formation of NaCl from sodium (Na),which is a metal, and chloride (Cl), which is a nonmetal

6 0

3 years ago

HELPPP!!! In reaction 2Sr+O2=2SrO how many moles of Oxygen will be needed to react with 36.9g of SrO?

Step2247 [10]

6000 I pretty sure tell me if it's right

6 0

2 years ago

Mercury chloride is a commercial fungicide. If the molar mass is 470 g/mol and the percent composition is 85.0% Hg and 15.0% Cl,

ElenaW [278]

Data: molar mass 470 g/mol

Percent composition:

Hg = 85.0%
Cl = 15.0%

Solution:

1) Convert % to molar ratios

A. Base: 100 g

=> Hg = 85.0 g / 200.59 g/mol = 0.4235 mol

Cl = 15.0 g / 35.45 g/mol = 0.4231 mol

B. divide by the higher number and round to whole number

Hg = 0.4325 / 0.4231 = 1.00

Cl = 0.4231 / 0.4231 = 1.00

=> Empirical formula = Hg Cl

2) Find the mass of the empirical formula:

HgCl: 200.59 g/mol + 35.45 g/mol = 236.04

3) Determine how many times is the empirical mass contained in the molecular mass:

470 g/mol / 236.04 = 1.99 ≈ 2

=> Molecular formula = Hg2 Cl2.

Answers:

Empirical formula HgCl
Molecular Formula Hg2Cl2

6 0

3 years ago