All categories

3 years ago

Which product(s) would be obtained by the dehydration of 2-heptanol? of 2-methyl-l-cyclohexanol?

1 answer:

5 0

Hello)
1)CH3-CH(OH)-СН2-СН2-СН2-СН2-СН3---(H2SO4)--›CH3-CH=CH-CH2-CH2-CH2-CH3+H2O
2)2-methyl-l-cyclohexanol---(h2so4)--›CH2=C(CH3)-CH2-CH2-CH2-CH2-CH3+H2O

You might be interested in

a solution of unknown molecular substance is prepared by dissolving 0.50g of the unknown in 8.0g of benzene. the solution freeze

spayn [35]

Answer:

THE MOLAR MASS OF THE UNKNOWN MOLECULAR SUBSTANCE IS 200 G/MOL.

Explanation:

Mass of the unknown substance = 0.50 g

Freezing point of the solution = 3.9 °C

Freezing point of pure benzene = 5.5 °C

Freezing point dissociation constant Kf = 5.12°C/m

First, calculate the temperature difference between the freezing point of pure benzene and the final solution freezing point.

Change in temperature = 5.5 -3.9 = 1.6 °C

Next is to calculate the number of moles or molarity of the compound that dissolved.

Using the formula:

Δt = i Kf m

Assume i = 1

So,

1.6 °C = 1 * 5.12 * x/ 0.005 kg of benzene

x = 1.6 * 0.008 / 5.12

x = 0.0128 / 5.12

x = 0.0025 moles.

Next is to calculate the molar mass using the formula, molarity = mass / molar mass

Molar mass = mass / molarity

Molar mass = 0.50 g /0.0025

Molar mass = 200 g/mol

Hence, the molar mass of the unknown compound is 200 g/mol

6 0

2 years ago

Hey how's ur friday going yall im bacc in school now so yay!

Naily [24]

My Friday is going good and I might get to go over to my BFF house!!!

6 0

2 years ago

What is the density of an object if its mass is 10 g and a volume of 2 mL?

Lilit [14]

Hi there! Let's solve this problem shall we!

⠀Volume = 10g

Mass = 2 mL

In this specific problem, they are asking us to find the density of the object. So, using the information given to us (volume and mass), let's solve the problem!

Now, if you remember, D = M ÷ V

So, let's fill in the blanks!

D = Our unknown value

M = 2mL

V = 10g

Here is the filled out formula:

D = M ÷ V

D = 2mL ÷ 10g

D = 5 g/mL

*Make sure you put the units for your final solution!*

4 0

1 year ago

Which answer provides the correct name for the following hydrocarbon?

ivanzaharov [21]

1) Hydrocarbon: CH3 - CH2 - CH2 - CH2 - CH3

2) Only single bonds => alkane => sufix ane

3) no substitutions

4) 5 carbons = > prefix penta.

Therefore, the name is pentane.

4 0

3 years ago

Read 2 more answers

What can be said about a reaction with H = 62.4 kJ/mol and S = 0.145 kJ/(mol·K)?

Zigmanuir [339]

Answer:

At 430.34 K the reaction will be at equilibrium, at T > 430.34 the reaction will be spontaneous, and at T < 430.4K the reaction will not occur spontaneously.

Explanation:

1) Variables:

G = Gibbs energy
H = enthalpy
S = entropy

2) Formula (definition)

G = H + TS

=> ΔG = ΔH - TΔS

3) conditions

ΔG < 0 => spontaneous reaction
ΔG = 0 => equilibrium
ΔG > 0 non espontaneous reaction

4) Assuming the data given correspond to ΔH and ΔS

ΔG = ΔH - T ΔS = 62.4 kJ/mol + T 0.145 kJ / mol * K

=> T = [ΔH - ΔG] / ΔS

ΔG = 0 => T = [ 62.4 kJ/mol - 0 ] / 0.145 kJ/mol*K = 430.34K

This is, at 430.34 K the reaction will be at equilibrium, at T > 430.34 the reaction will be spontaneous, and at T < 430.4K the reaction will not occur spontaneously.

3 0

3 years ago

Read 2 more answers