The car will have more momentum because it has a greater mass. Momentum= mass x velocity therefore if both the objects have the same velocity the object with a greater mass will have more momentum
Objects would be like a lap, stove, & microwave. There’s many options.
Answer: The pressure will be 18.05 atm.
Explanation: Expression for ideal gas equation is :
where,
P = Pressure of the gas = ? atm
V = Volume of the gas = 0.333L
n = Number of moles of gas = 0.250 moles
R = Universal gas constant = 
T = temperature of the gas = 20°C = (273 + 20)K = 293K
Putting values in above equation, we get:
P = 18.05 atm
2,3,5-trimethylhexane
C9H20
Molecular weight= 128.5g/mol
CH3-CH(CH3)-CH(CH3)-CH2-CH(CH3)-CH3
Answer:
<h2>30.2 g</h2>
Explanation:
The mass of a substance when given the density and volume can be found by using the formula
mass = Density × volume
volume = final volume of water - initial volume of water
From the question
volume = 35.9 ml - 25.8 ml = 10.1 mL
We have
mass = 2.99 × 10.1 = 30.199 g
We have the final answer as
<h3>30.2 g</h3>
Hope this helps you
