It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs
The total volume of water that would be removed will be 75 mL
<h3>Dilution equation</h3>
Using the dilution equation:
M1V1 = M2V2
In this case, M1 = 500 mL, V1 = 10.20 M, M2 = 12 M
Substitute:
V2 = 500 x 10.20/12
= 425 mL
The final volume in order to arrive at 12 M HNO3 would be 425 mL from the initial 500 mL. Thus, the total amount of water that will be removed by evaporation can be calculated as:
500 - 425 = 75 mL
More on dilution can be found here: brainly.com/question/7208939
Answer:
2
Explanation:
Thermal, chemical and electromagnetic is the right answer
If I'm correct, the crater is actually a circular-shaped area around the volcano's central vent. My answer is false
