All categories

4 years ago

NaI+pb(so4)2=Pbi4+Na2(so4) How do you balance this equation

Chemistry

1 answer:

Ipatiy [6.2K]4 years ago

6 0

Answer:

By putting a coefficient 4 on NaI and 2 on Na₂SO₄

4NaI + Pb(SO₄)₂ → Pbi4 + 2Na₂SO₄

Explanation:

A chemical equation is balanced for it to obey the law of conservation of mass.
According to the law of conservation of mass, the mass of the reactants should be equal to the mass of products.
Balancing involves putting coefficients on reactants and products to get an equal number of atoms of each element on either side of the equation.
In this case, putting a coefficient four on NaI and two on Na₂SO₄ will make the equation to be balanced.

Therefore, the balanced chemical equation is;

4NaI + Pb(SO₄)₂ → Pbi4 + 2Na₂SO₄

You might be interested in

When Silver (Ag) forms a metallic bond with other Silver atoms, what do the valence electrons move into? A. the all go to the sa

Korolek [52]

Answer:

D. the sea of electrons

Explanation:

Metallic bonds are defined as the bonds formed between two or more metals. Silver atom form metallic bond with other silver atoms.

In metallic bond, the free electrons or valence electrons present in s and p orbitals delocalize. The valence electrons do not move around the atoms or enter the atoms whereas they form a sea of electrons in which they surround the nuclei (positively charged) of the metal ions interacting. The valence electrons are then freely move in the space between the atomic nuclei.

Hence, the correct answer is "D. the sea of electrons".

7 0

4 years ago

Convert 7.50 grams of glucose C6H12O6 to moles

Lera25 [3.4K]

Answer:

The number of mole is 0.04167mole

Explanation:

To convert gram to mole, we need to calculate the molecular weight of the compound

C6H12O6

C - 12

H - 1

O - 16

Molecular weight = 6 * 12 + 1 *12 + 6 * 16

= 72 + 12 + 96

= 180g/mol

To covert gram to mole

Therefore,

= 7.50g/ 180g/mol

= 0.04167 mole of glucose

3 0

3 years ago

Consider the following reaction: CH3OH(g)⇌CO(g)+2H2(g) Part A Calculate ΔG for this reaction at 25 ∘C under the following condit

kati45 [8]

<u>Answer:</u> The $\Delta G$ of the reaction at given temperature is -12.964 kJ/mol.

<u>Explanation:</u>

For the given chemical reaction:

$CH_3OH(g)\rightleftharpoons CO(g)+2H_2(g)$

The expression of $K_p$ for the given reaction:

$K_p=\frac{(p_{CO})\times (p_{H_2}^2)}{p_{CH_3OH}}$

We are given:

$p_{CO}=0.140atm\\p_{H_2}=0.180atm\\p_{CH_3OH}=0.850atm$

Putting values in above equation, we get:

$K_p=\frac{(0.140)\times (0.180)^2}{0.850}\\\\K_p=5.34\times 10^{-3}$

To calculate the Gibbs free energy of the reaction, we use the equation:

$\Delta G=\Delta G^o+RT\ln K_p$

where,

$\Delta G$ = Gibbs' free energy of the reaction = ?

$\Delta G^o$ = Standard gibbs' free energy change of the reaction = 0 J (at equilibrium)

R = Gas constant = $8.314J/K mol$

T = Temperature = $25^oC=[25+273]K=298K$

$K_p$ = equilibrium constant in terms of partial pressure = $5.34\times 10^{-3}$

Putting values in above equation, we get:

$\Delta G=0+(8.314J/K.mol\times 298K\times \ln(5.34\times 10^{-3}))\\\\\Delta G=-12963.96J/mol=-12.964kJ/mol$

Hence, the $\Delta G$ of the reaction at given temperature is -12.964 kJ/mol.

5 0

4 years ago

HBr can be added to an alkene in the presence of peroxides (ROOR). What function does the peroxide serve in this reaction

RSB [31]

Answer:

Radical chain initiator

Explanation:

The peroxide here serves as a radical chain initiator. In the field of chemistry the radical initiatives are those substances that are used in industrial processes like polymer synthesis. These initiatives have weak bonds generally and they're mostly used to create free radicals. These radicals are atoms that have odd numbers of electrons. Peroxide is an example of such.

6 0

3 years ago

39 Which Kelvin temperature is equal to 200.oC?(1) -73 K (2) 73 K (3) 200. K (4) 473 K

nikdorinn [45]

0K = -273C
So 473K = 200C
The answer is 4

5 0

4 years ago