Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Taking into account the reaction stoichiometry, 340.0 moles of methane are produced when 85.1 moles of carbon dioxide gas react with excess hydrogen gas
<h3>Reaction stoichiometry</h3>
In first place, the balanced reaction is:
CO₂ + 4 H₄ → CH₄ + 2 H₂O
By reaction stoichiometry (that is, the relationship between the amount of reagents and products in a chemical reaction), the following amounts of moles of each compound participate in the reaction:
- CO₂: 1 mole
- H₄: 4 moles
- CH₄: 1 mole
- H₂O: 2 moles
<h3>Moles of CH₄ formed</h3>
The following rule of three can be applied: if by reaction stoichiometry 1 mole of CO₂ form 4 moles of CH₄, 85.1 moles of CO₂ form how many moles of CH₄?

<u><em>moles of CH₄= 340.4 moles</em></u>
Then, 340.0 moles of methane are produced when 85.1 moles of carbon dioxide gas react with excess hydrogen gas
Learn more about the reaction stoichiometry:
brainly.com/question/24741074
brainly.com/question/24653699
#SPJ1
Answer:
3.45 x 10^24 x 1 / 6.022 x 10^23 = 573
Answer:
A) 122 atm
Explanation:
PV = nRT
Solve for P --> P = nRT/V
n = 10.0 mol + 5.0 mol = 15.0 mol
R = 0.08206 L atm / mol K
T = 25 + 273 = 298 K
V = 3.0
P = (15.0)(0.08206)(298) / (3.0) = 122 atm