Include:
- Adding cleanser makes the paperclip fall through the water to the base of the dish.
- Soap is a surfactant.
- Surfactants lessen the surface pressure of a fluid.
- The surface strain of water is the thing that upheld the paper cut.
The answer is TRUE.
If the Energy is on the left, then the problem is true. If it is on the right then it would be negative, false, and considered as exothermic.
Endothermic reaction = the products are higher in energy than the reactants.
Exothermic reaction = a chemical reaction that releases energy by light or heat.
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
I would say d
Hope that helps :)
Answer:
The answer is c( to send signals to control the body)
