cold
less plants
less rain
dry winds
permanent frozen ground called permafrost
Answer:
Total worth of gold in the ocean = $5,840,000,000,000,000
Explanation:
As stated in the question above, 4.0 x 10^-10 g of gold was present in 2.1mL of ocean water.
Therefore, In 1 L of ocean water there will be,
(4.0 x 10^-10)/0.0021
= 1.9045 x 10^-7 g of gold per Liter of ocean water.
So in 1.5 x 10^-21 L of ocean water, there will be
(1.9045 x 10^-7) * (1.5 x 10^-21)
= 2.857 x 10^14 g of gold in the ocean.
1 gram of gold costs $20.44, that is 20.44 dollars/gram. The total cost of the gold present in the ocean is
20.44 * (2.857 x 10^14)
= $5,840,000,000,000,000
If you only want to balance nuclear reactions, then you should know that number of nucleons are conserved before and after nuclear reaction. Also, charge is conserved as well.
Other things which are conserved in a nuclear reaction are:
Conservation of:
1. Parity
2. Spin
3. angular momentum(vector sum of intrinsic spin and orbital angular momentum)
4. linear momentum
5. Isotopic spin
6. Energy
Colder- moves slower
warmer- moves faster
changes state:
solid to gas- warmer
gas to solid- colder
something like that
The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
