Answer:
P.E = 25.48 J
Explanation:
Given data:
Mass = 2 Kg
Height = 1.3 m
Potential energy = ?
Solution:
Formula:
P.E = m . g . h
P. E = potential energy
m = mass in kilogram
g = acceleration due to gravity
h = height
Now we will put the values in formula.
P.E = m . g . h
P.E = 2 Kg . 9.8 m /s² . 1.3 m
P.E = 25.48 Kg. m² / s²
Kg. m² / s² = J
P.E = 25.48 J
Answer:
more electron deficient
Explanation:
The nitro group is an electron withdrawing group. It withdraws electrons from the pyridine ring by resonance.
This electron withdrawal by resonance makes the pyridine ring less electron rich or more electron deficient.
Hence, the nitro group makes the pyrinde ring more electron deficient
Explanation:
It is known that 1 gram contains 1000 milligrams. And, mathematically we can represent it as follows.
or 
So, when we have to convert grams into milligrams then we simply multiply the digit with 1000. And, if we have to convert a digit from milligrams to grams then we simply divide it by 1000.
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
If you start with 0.30 m Mn₂ , at 12.5 pH, free Mn₂ concentration be equal to 4.6 x 10⁻¹¹ m
Initial molarity of Mn₂ = 0.30 M
Final molarity of Mn₂ = 4.6 x 10⁻¹¹
pH = ?
Ksp [Mn(OH)₂] = 4.6 x 10⁻¹⁴ (standard value)
Write the ionic equation
Mn(OH)₂ → Mn⁺² + 2OH⁻
[Mn⁺²] = 4.6 x 10⁻¹¹
We will calculate the concentration of OH⁻ by using Ksp expression
Ksp = [Mn⁺²][OH-]²
[Mn⁺²][OH⁻]² = 4.6 x 10⁻¹⁴
[OH⁻]² = 4.6 x 10⁻¹⁴ / 4.6 x 10⁻¹¹
[OH⁻]² = 10⁻³
[OH⁻] = (10⁻³)¹⁽²
[OH⁻] = 0.0316 M
Calculate the pOH
pOH = -log [OH⁻]
pOH = -log [0.0316]
pOH = 1.5
Now calculate pH
pH = 14 - pOH
pH = 14 - 1.5
pH = 12.5
You can also learn about molarity from the following question:
brainly.com/question/14782315
#SPJ4
