The stored chemical energy in fuels is MOST OFTEN converted to _________ and _________ energy through combustion.
1 answer:
You might be interested in
Answer:
Sin(60°)=
Explanation:
Assuming the given angles are in degrees
We know that Sin(A-B)=SinACosB-CosASinB
Here A=100° and B=40°
We are given distance of the center of the source for two waves:
C) Calculating how their phases compares:
ΔФ240ΔФ60
ΔФ60 = 4.ΔФ60
How can you determine a wave's phase?
- The period, or length of each cycle, is determined by dividing the frequency by 1, so 1/100 corresponds to a period of 0.01 seconds. The phase shift equation is given by ps = 360 * td / p, where td is the time interval between waves, p is the wave period, and ps is the phase shift in degrees.
Phase: The "Phase" of a waveform refers to the location of the moving particle and is expressed in "Radians or degrees."
Phase difference, also known as "Phase angle," is the amount of time that one wave precedes or follows another.
To learn more about Phase of the wave, visit:
#SPJ4