I can't answer it if I can't see the image.
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
539.421ml would be the correct conversion
Answer:
Stoichiometry measures these quantitative relationships, and is used to determine the amount of products and reactants that are produced or needed in a given reaction. Describing the quantitative relationships among substances as they participate in chemical reactions is known as reaction stoichiometry.
Explanation:
The specific heat, c is 0.75 J/g°C
<u>Explanation:</u>
Heat or Energy, Q = 1500J
Mass, m = 50g
T1 = 0°C
T2 = 40°C
Specific Heat, c = ?
We know,
Q = mcΔT
Q = mc(T2-T1)
1500 = 50 X c X (40-0)
1500 = 50 X c X 40
c = 1500/ 2000
c = 0.75 J/g°C
Therefore, the specific heat, c is 0.75 J/g°C
