The type of reaction caused by particle accelerators is called photo-fission reaction
Answer:
See details below
Explanation:
The balanced reaction equation is given below:
+ 
→ 
+ 
Mole fraction of CO2 to H20
= 8/10 = 
Mole ratio of C4H10 to CO2 is 2:8 = 1:4
1 mole of n-butane - 38.12 g
4 moles - ?
= 152.48g fuel consumed.
Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543
It seems that you have missed to attach the given map and options for us to answer this question, so I had to look for it. Anyway, here is the answer. The statement that best describes the whether shown by the purple combination of semicircles and triangles on a line on a weather map is a <span>cold front can cause heavy rain, thunder, and lightning. Hope this helps.</span>
Answer:
Explanation:
The amine functional group is obtained by subsititution of one or more hydrogen atoms in the ammonia compound.
Ammonia is NH₃.
Then,
- by substituting one hydrogen you obtain R - NH₂.
- by substituting two hydrogens you obtain R' - NH - R''
- by subsituting the three hydrogens you obtain:
R'''
|
R' - N - R''
In this case, the three subsitutuents are silyl groups. The silyl group is derived form silane and is SiH₃. So, the tcompound <em>trisilylamine</em> is:
SiH₃
|
SiH₃ - N - SiH₃
Thus, you can count 3 hydrogen atoms for every silylgroup for a total of <u><em>9 hydrogen atoms in each molecule of trisilylamine.</em></u>
