Answer:
HF
Explanation:
This concept can be understood from the knowledge of Intermolecular forces of attraction.
Intermolecular bonds are Van der Waals forces which are weak forces of attraction joining non-polar and polar molecules together. They exist in the form of London Dispersion Forces and Dipole-dipole attraction.
An example of Dipole-dipole attraction is the hydrogen bond which is a unique dipole-dipole attraction between polar molecules in which a hydrogen atom is directly joined to a highly electronegative atom such as fluorine, oxygen, or nitrogen).
Molecules that possess the characteristics of hydrogen bonding have a higher boiling point. In the given question, only HF undergo hydrogen bond due to the electronegative effect of the fluorine element.
F2 occurs as a weak London dispersion force and it occurs between non-polar molecules.
According to what is known about chemical equilibrium and Le Chatelier's principle, when you increase the amount of the reactants, the reaction will be moved to the products, this is because, the most reactants we have the most products we can produce.
From the given choices, the one that goes according to this reason is the third one: The volume of water vapor increases.
"NH4+ <----> NH3 + H+
The constant of this equilibrium is: K = Kw / Kb = 1 x 10^-14 / 1.8 x 10^-5 =5.56 x 10^-10
5.56 x 10^-10 = x^2 / 0.20-x
x = [H+] =1.1 x 10^-5 M
pH = 5.0"
Answer:
Explanation:
We have two pressures, two temperatures, and one volume.
This looks like a question in which we can use the Combined Gas Law to calculate the volume.
Data:
Calculation:
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
