Answer:
5.61 * 10²¹ molecules
Explanation:
You have 1.25 g of malic acid, C4H.Os, an acid found in apples and other fruits. How many molecules of the acid do you have?
Solution:
A molecule is the group of two or more atoms held together by chemical bonds.
The number of molecules is calculated using the formula:
number of molecules in a substance = number of moles of substance * Avogadro constant
Avogadro constant = 6.02 * 10²³ mol⁻¹
number of moles = mass / molar mass
Given that mass = 1.25 g
molar mass of malic acid (C₄H₆O₅) = (12 * 4) + (1 * 6) + (16 * 5) = 48 + 6 + 80 = 134 g/mol
number of moles = mass / molar mass = 1.25 g / 134 g/mol = 0.0093 mol
Recall that: number of molecules in a substance = number of moles of substance * Avogadro constant
number of molecules in a substance = 0.0093 mol * 6.02 * 10²³ mol⁻¹ = 5.61 * 10²¹ molecules
<u>standardization of a volumetric solutio</u><u>n used for titration is one of the most important preconditions for reliable and transparent titration results.</u>
Properties of the following are:
Alpha particle - positively charged particle (+) that consists of two electrons and two neutrons.
Cathode rays - it is the stream of electrons (negatively charged) found in vacuum.
Protons - are particles that carry positive charge and is present inside the nucleus of an atom.
Electrons - are particles that carry negative charge and is present in the orbits of the atom.
Neutrons - electrically neutral particle (0 charge) present inside the nucleus of an atom. However, it has its own mass.
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
Answer : The value of diffusion coefficient is, 
Explanation :
Formula used :
where,
D = diffusion coefficient = ?
= 
= 
R = gas constant = 8.314 J/mol.K
T = temperature = 
Now put all the given values in the above formula, we get:
Thus, the value of diffusion coefficient is,
