All categories

3 years ago

Explain how information from stimuli becomes a memory

1 answer:

6 0

Answer: A stimulus is something which can bring change in the physiology of the organism and can generate an immune response.

Explanation:

The information from stimuli is passed from the sensory memory to the short duration memory through the process of cognitive process. In the cognitive process the one aspect of the environment is concentrated and the other aspects are ignored. This helps in registering the effect of stimulus on the brain and its retention in the memory and also filters the unwanted stimuli.

You might be interested in

Which of the following represent a mixture?

7nadin3 [17]

The answer is B NaCI solid

6 0

3 years ago

slader Consider the following reactions: A. uranium-238 emits an alpha particle; B. plutonium-239 emits an alpha parti- cle; C.

pishuonlain [190]

Answer:

For A: The equation is $_{92}^{238}\textrm{U}\rightarrow _{90}^{234}\textrm{Th}+_2^4\alpha$

For B: The equation is $_{94}^{239}\textrm{Pu}\rightarrow _{92}^{235}\textrm{U}+_2^4\alpha$

For C: The equation is $_{90}^{239}\textrm{Th}\rightarrow _{91}^{235}\textrm{Pa}+_{-1}^0\beta$

Explanation:

Alpha decay process is the process in which nucleus of an atom disintegrates into two particles. The first one which is the alpha particle consists of two protons and two neutrons. This is also known as helium nucleus. The second particle is the daughter nuclei which is the original nucleus minus the alpha particle released.

$_Z^A\textrm{X}\rightarrow _{Z-2}^{A-4}\textrm{Y}+_2^4\alpha$

Beta decay process is defined as the process the neutrons get converted into an electron and a proton. The released electron is known as the beta particle. In this process, the atomic number of the daughter nuclei gets increased by a factor of 1 but the mass number remains the same.

$_Z^A\textrm{X}\rightarrow _{Z+1}^A\textrm{Y}+_{-1}^0\beta$

For A: Uranium-238 emits an alpha particle

The nuclear equation for this process follows:

$_{92}^{238}\textrm{U}\rightarrow _{90}^{234}\textrm{Th}+_2^4\alpha$

For B: Plutonium-239 emits an alpha particle

The nuclear equation for this process follows:

$_{94}^{239}\textrm{Pu}\rightarrow _{92}^{235}\textrm{U}+_2^4\alpha$

For C: Thorium-239 emits a beta particle

The nuclear equation for this process follows:

$_{90}^{239}\textrm{Th}\rightarrow _{91}^{235}\textrm{Pa}+_{-1}^0\beta$

6 0

3 years ago

If you are calculating the grams to mL ratio, you are trying to find the object’s…

Alex

Answer:

Density

Explanation:

The ratio of mass to the volume of an object is called its density. Unit of mass is grams and that of volume is mL.

Density = mass/volume

$\text{Density}=\dfrac{\text{grams}}{\text{mL}}\\\\=\text{grams/mL}$

If you are calculating the grams to mL ratio, it means that we are trying to find the object's density.

4 0

3 years ago

31. Adding an additional oxygen atom to 02 creates....

cricket20 [7]

It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs

4 0

3 years ago

What is the most soluble salt of the following set? What is the most soluble salt of the following set?

DiKsa [7]

Answer:

Explanation:

The solubility product of a solid is the amount of solid dissociates into its respective ions in the solution. Thus more the value of the Ksp, the more is the salt soluble in the solvent.

So, Given that:-

$Sn(OH)_2\ (K_{sp} =1.6\times 10^{-19})$

$Al(OH)_3\ (K_{sp} =1.9\times 10^{-33})$

$AgCN\ (K_{sp} =6.0\times 10^{-17})$

$Fe(OH)_3\ (K_{sp} =2.6\times 10^{-39})$

The salt having highest value of Ksp is AgCN. So, it is most soluble.

4 0

3 years ago