Color change is most indicative of which type of chemical reaction?

Which product(s) would be obtained by the dehydration of 2-heptanol? of 2-methyl-l-cyclohexanol?

Komok [63]

Hello)
1)CH3-CH(OH)-СН2-СН2-СН2-СН2-СН3---(H2SO4)--›CH3-CH=CH-CH2-CH2-CH2-CH3+H2O
2)2-methyl-l-cyclohexanol---(h2so4)--›CH2=C(CH3)-CH2-CH2-CH2-CH2-CH3+H2O

5 0

3 years ago

1 point

Elina [12.6K]

Answer:

84672 J

Explanation:

From the question given above, the following data were obtained:

Height (h) = 72 m

Combined mass (m) = 120 Kg

Acceleration due to gravity (g) = 9.8 m/s²

Energy (E) =?

We can obtain the energy by using the following formula:

E = mgh

Where

E => is the energy.

g => is the acceleration due to gravity

m => is the mass.

h => is the height.

E = 120 × 9.8 × 72

E = 84672 J

Thus, the energy is 84672 J

6 0

3 years ago

What element has a proton number of 79?

PtichkaEL [24]

Gold has 79 protons on the periodic table

3 0

3 years ago

Read 2 more answers

If you combine 230.0 mL 230.0 mL of water at 25.00 ∘ C 25.00 ∘C and 120.0 mL 120.0 mL of water at 95.00 ∘ C, 95.00 ∘C, what is t

Thepotemich [5.8K]

Answer: The final temperature of the mixture is 49°C

Explanation:

To calculate the mass of water, we use the equation:

$\text{Density of substance}=\frac{\text{Mass of substance}}{\text{Volume of substance}}$

For cold water:

Density of cold water = 1 g/mL

Volume of cold water = 230.0 mL

Putting values in above equation, we get:

$1g/mL=\frac{\text{Mass of water}}{230.0mL}\\\\\text{Mass of water}=(1g/mL\times 230.0mL)=230g$

For hot water:

Density of hot water = 1 g/mL

Volume of hot water = 120.0 mL

Putting values in above equation, we get:

$1g/mL=\frac{\text{Mass of water}}{120.0mL}\\\\\text{Mass of water}=(1g/mL\times 120.0mL)=120g$

When hot water is mixed with cold water, the amount of heat released by hot water will be equal to the amount of heat absorbed by cold water.

$Heat_{\text{absorbed}}=Heat_{\text{released}}$

The equation used to calculate heat released or absorbed follows:

$Q=m\times c\times \Delta T=m\times c\times (T_{final}-T_{initial})$

$m_1\times c\times (T_{final}-T_1)=-[m_2\times c\times (T_{final}-T_2)]$ ......(1)

where,

q = heat absorbed or released

$m_1$ = mass of hot water = 120 g

$m_2$ = mass of cold water = 230 g

$T_{final}$ = final temperature = ?°C

$T_1$ = initial temperature of hot water = 95°C

$T_2$ = initial temperature of cold water = 25°C

c = specific heat of water = 4.186 J/g°C

Putting values in equation 1, we get:

$120\times 4.186\times (T_{final}-95)=-[230\times 4.186\times (T_{final}-25)]$

$T_{final}=49^oC$

Hence, the final temperature of the mixture is 49°C

4 0

3 years ago

NH3 + HCl---> NH4Cl What is the Chemical reaction

KATRIN_1 [288]

Answer:

A combination reaction

Explanation:

The chemical reaction between ammonia and hydrochloric acid as shown below:

NH₃ + HCl → NH₄Cl

is a combination reaction.

In a combination reaction, two compounds combines together to give one compound.

A combination reaction is also known as a synthesis reaction.

A single product forms from tow or more reactants.

The driving force for such reaction is the large and negative heat of formation of the product.

5 0

3 years ago