<u>Given:</u>
Concentration of Ba(OH)2 = 0.348 M
<u>To determine:</u>
pOH of the above solution
<u>Explanation:</u>
Based on the stoichiometry-
1 mole of Ba(OH)2 is composed of 1 mole of Ba2+ ion and 2 moles of OH- ion
Therefore, concentration of OH- ion = 2*0.348 = 0.696 M
pOH = -log[OH-] = - log[0.696] = 0.157
Ans: pOH of 0.348M Ba(OH)2 is 0.157
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
