We call these reactive elements, becausethese atoms really like to follow the buddysystem and form bonds with other atoms.Noble gases, however, don't have thisproblem. Their outer shells are filled to the max, so they don't need to bond or react with any other atoms.
When you doing a titration, you need to use an indicator to confirm whether the reaction is completed. When the indicator has the color change and will not change back in one minute, the reaction is finished and you don't need to add more.
Answer:
Oxygen is a reactant of cellular respiration, while being the product for photosynthesis
Explanation:
Photosynthesis
carbon + water + sunlight -> oxygen and glucose
Cellular respiration
oxygen + glucose -> carbon + water + ATP
Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543
The buoyancy of an object is dictated by its density. So let us calculate for density, where:density = mass / volume
Calculate the volume first of a solid cube:volume = (6 cm)^3 = 216 cm^3 = 216 mL
Therefore density is:density = 270 g / 216 mLdensity = 1.25 g / mL
Therefore this object will float in the layer in which the density is more than 1.25 g / mL.
