Answer:
substance
Explanation:
A mixture is when two or more <u>different</u> atoms/molecules are together, but not joined.
A substance is when the <u>same </u>atom/molecule is in a group together.
In this example, it is a substance because it is comprised of the same molecule not joined all together. If you wanted a mixture, other colored atoms/molecule (e.g. add green atoms) would change it to this property.
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer:
Add Iodine-KI reagent to a solution or directly on a potato or other materials such as bread, crackers, or flour. A blue-black color results if starch is present. If starch amylose is not present, then the color will stay orange or yellow